# HG changeset patch # User Matt Johnston # Date 1087318075 0 # Node ID b939f2d4431e298a71daf02ebb962460664158ff # Parent 712dd6dfb0eb35c1e890ef1754208ffc74e1d7bb Include files accidentally zeroed when merging 0.96 release diff -r 712dd6dfb0eb -r b939f2d4431e crypt_hash_descriptor.c --- a/crypt_hash_descriptor.c Tue Jun 15 14:34:07 2004 +0000 +++ b/crypt_hash_descriptor.c Tue Jun 15 16:47:55 2004 +0000 @@ -0,0 +1,17 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@iahu.ca, http://libtomcrypt.org + */ +#include "mycrypt.h" + +struct _hash_descriptor hash_descriptor[TAB_SIZE] = { +{ NULL, 0, 0, 0, { 0x00 }, 0, NULL, NULL, NULL, NULL }, +{ NULL, 0, 0, 0, { 0x00 }, 0, NULL, NULL, NULL, NULL }, +{ NULL, 0, 0, 0, { 0x00 }, 0, NULL, NULL, NULL, NULL }, +{ NULL, 0, 0, 0, { 0x00 }, 0, NULL, NULL, NULL, NULL } }; diff -r 712dd6dfb0eb -r b939f2d4431e demos/small.c --- a/demos/small.c Tue Jun 15 14:34:07 2004 +0000 +++ b/demos/small.c Tue Jun 15 16:47:55 2004 +0000 @@ -0,0 +1,11 @@ +// small demo app that just includes a cipher/hash/prng + +#include + +int main(void) +{ + register_cipher(&rijndael_enc_desc); + register_prng(&yarrow_desc); + register_hash(&sha256_desc); + return 0; +} diff -r 712dd6dfb0eb -r b939f2d4431e makefile.msvc --- a/makefile.msvc Tue Jun 15 14:34:07 2004 +0000 +++ b/makefile.msvc Tue Jun 15 16:47:55 2004 +0000 @@ -0,0 +1,88 @@ +#MSVC Makefile [tested with MSVC 6.00 with SP5] +# +#Tom St Denis +CFLAGS = /I. /Ox /DWIN32 /W3 + +default: library + +# leave this blank and link against libtommath if you want better link resolution +MPIOBJECT=mpi.obj + +OBJECTS=error_to_string.obj mpi_to_ltc_error.obj base64_encode.obj base64_decode.obj \ +\ +crypt.obj crypt_find_cipher.obj crypt_find_hash_any.obj \ +crypt_hash_is_valid.obj crypt_register_hash.obj crypt_unregister_prng.obj \ +crypt_argchk.obj crypt_find_cipher_any.obj crypt_find_hash_id.obj \ +crypt_prng_descriptor.obj crypt_register_prng.obj crypt_cipher_descriptor.obj \ +crypt_find_cipher_id.obj crypt_find_prng.obj crypt_prng_is_valid.obj \ +crypt_unregister_cipher.obj crypt_cipher_is_valid.obj crypt_find_hash.obj \ +crypt_hash_descriptor.obj crypt_register_cipher.obj crypt_unregister_hash.obj \ +\ +sprng.obj yarrow.obj rc4.obj rng_get_bytes.obj rng_make_prng.obj \ +\ +rand_prime.obj is_prime.obj \ +\ +ecc.obj dh.obj \ +\ +rsa_decrypt_key.obj rsa_encrypt_key.obj rsa_exptmod.obj rsa_free.obj rsa_make_key.obj \ +rsa_sign_hash.obj rsa_verify_hash.obj rsa_export.obj rsa_import.obj tim_exptmod.obj \ +\ +dsa_export.obj dsa_free.obj dsa_import.obj dsa_make_key.obj dsa_sign_hash.obj \ +dsa_verify_hash.obj dsa_verify_key.obj \ +\ +aes.obj aes_enc.obj \ +\ +blowfish.obj des.obj safer_tab.obj safer.obj saferp.obj rc2.obj xtea.obj \ +rc6.obj rc5.obj cast5.obj noekeon.obj twofish.obj skipjack.obj \ +\ +md2.obj md4.obj md5.obj sha1.obj sha256.obj sha512.obj tiger.obj whirl.obj \ +rmd128.obj rmd160.obj \ +\ +packet_store_header.obj packet_valid_header.obj \ +\ +eax_addheader.obj eax_decrypt.obj eax_decrypt_verify_memory.obj eax_done.obj eax_encrypt.obj \ +eax_encrypt_authenticate_memory.obj eax_init.obj eax_test.obj \ +\ +ocb_decrypt.obj ocb_decrypt_verify_memory.obj ocb_done_decrypt.obj ocb_done_encrypt.obj \ +ocb_encrypt.obj ocb_encrypt_authenticate_memory.obj ocb_init.obj ocb_ntz.obj \ +ocb_shift_xor.obj ocb_test.obj s_ocb_done.obj \ +\ +omac_done.obj omac_file.obj omac_init.obj omac_memory.obj omac_process.obj omac_test.obj \ +\ +pmac_done.obj pmac_file.obj pmac_init.obj pmac_memory.obj pmac_ntz.obj pmac_process.obj \ +pmac_shift_xor.obj pmac_test.obj \ +\ +cbc_start.obj cbc_encrypt.obj cbc_decrypt.obj cbc_getiv.obj cbc_setiv.obj \ +cfb_start.obj cfb_encrypt.obj cfb_decrypt.obj cfb_getiv.obj cfb_setiv.obj \ +ofb_start.obj ofb_encrypt.obj ofb_decrypt.obj ofb_getiv.obj ofb_setiv.obj \ +ctr_start.obj ctr_encrypt.obj ctr_decrypt.obj ctr_getiv.obj ctr_setiv.obj \ +ecb_start.obj ecb_encrypt.obj ecb_decrypt.obj \ +\ +hash_file.obj hash_filehandle.obj hash_memory.obj \ +\ +hmac_done.obj hmac_file.obj hmac_init.obj hmac_memory.obj hmac_process.obj hmac_test.obj \ +\ +pkcs_1_mgf1.obj pkcs_1_oaep_encode.obj pkcs_1_oaep_decode.obj \ +pkcs_1_pss_encode.obj pkcs_1_pss_decode.obj pkcs_1_i2osp.obj pkcs_1_os2ip.obj \ +pkcs_1_v15_es_encode.obj pkcs_1_v15_es_decode.obj pkcs_1_v15_sa_encode.obj pkcs_1_v15_sa_decode.obj \ +\ +pkcs_5_1.obj pkcs_5_2.obj \ +\ +burn_stack.obj zeromem.obj \ +$(MPIOBJECT) + +#ciphers come in two flavours... enc+dec and enc +aes_enc.obj: aes.c aes_tab.c + $(CC) $(CFLAGS) /DENCRYPT_ONLY /c aes.c /Foaes_enc.obj + +library: $(OBJECTS) + lib /out:tomcrypt.lib $(OBJECTS) + +x86_prof: demos/x86_prof.c library + cl $(CFLAGS) demos/x86_prof.c tomcrypt.lib advapi32.lib + +tv_gen: demos/tv_gen.c library + cl $(CFLAGS) demos/tv_gen.c tomcrypt.lib advapi32.lib + +hashsum: demos/hashsum.c library + cl $(CFLAGS) demos/hashsum.c tomcrypt.lib advapi32.lib diff -r 712dd6dfb0eb -r b939f2d4431e sha224.c --- a/sha224.c Tue Jun 15 14:34:07 2004 +0000 +++ b/sha224.c Tue Jun 15 16:47:55 2004 +0000 @@ -0,0 +1,98 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@iahu.ca, http://libtomcrypt.org + */ + +/* SHA-224 new NIST standard based off of SHA-256 truncated to 224 bits */ +const struct _hash_descriptor sha224_desc = +{ + "sha224", + 10, + 28, + 64, + + /* DER identifier (not supported) */ + { 0x00 }, + 0, + + &sha224_init, + &sha256_process, + &sha224_done, + &sha224_test +}; + +/* init the sha256 er... sha224 state ;-) */ +void sha224_init(hash_state * md) +{ + _ARGCHK(md != NULL); + + md->sha256.curlen = 0; + md->sha256.length = 0; + md->sha256.state[0] = 0xc1059ed8UL; + md->sha256.state[1] = 0x367cd507UL; + md->sha256.state[2] = 0x3070dd17UL; + md->sha256.state[3] = 0xf70e5939UL; + md->sha256.state[4] = 0xffc00b31UL; + md->sha256.state[5] = 0x68581511UL; + md->sha256.state[6] = 0x64f98fa7UL; + md->sha256.state[7] = 0xbefa4fa4UL; +} + +int sha224_done(hash_state * md, unsigned char *hash) +{ + unsigned char buf[32]; + int err; + + err = sha256_done(md, buf); + memcpy(hash, buf, 28); +#ifdef CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + return err; +} + +int sha224_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char hash[28]; + } tests[] = { + { "abc", + { 0x23, 0x09, 0x7d, 0x22, 0x34, 0x05, 0xd8, + 0x22, 0x86, 0x42, 0xa4, 0x77, 0xbd, 0xa2, + 0x55, 0xb3, 0x2a, 0xad, 0xbc, 0xe4, 0xbd, + 0xa0, 0xb3, 0xf7, 0xe3, 0x6c, 0x9d, 0xa7 } + }, + { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", + { 0x75, 0x38, 0x8b, 0x16, 0x51, 0x27, 0x76, + 0xcc, 0x5d, 0xba, 0x5d, 0xa1, 0xfd, 0x89, + 0x01, 0x50, 0xb0, 0xc6, 0x45, 0x5c, 0xb4, + 0xf5, 0x8b, 0x19, 0x52, 0x52, 0x25, 0x25 } + }, + }; + + int i; + unsigned char tmp[28]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha224_init(&md); + sha224_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha224_done(&md, tmp); + if (memcmp(tmp, tests[i].hash, 28) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + diff -r 712dd6dfb0eb -r b939f2d4431e sha256.c --- a/sha256.c Tue Jun 15 14:34:07 2004 +0000 +++ b/sha256.c Tue Jun 15 16:47:55 2004 +0000 @@ -0,0 +1,312 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@iahu.ca, http://libtomcrypt.org + */ + + +/* SHA256 by Tom St Denis */ + +#include "mycrypt.h" + +#ifdef SHA256 + +const struct _hash_descriptor sha256_desc = +{ + "sha256", + 0, + 32, + 64, + + /* DER identifier */ + { 0x30, 0x31, 0x30, 0x0D, 0x06, 0x09, 0x60, 0x86, + 0x48, 0x01, 0x65, 0x03, 0x04, 0x02, 0x01, 0x05, + 0x00, 0x04, 0x20 }, + 19, + + &sha256_init, + &sha256_process, + &sha256_done, + &sha256_test +}; + +#ifdef SMALL_CODE +/* the K array */ +static const unsigned long K[64] = { + 0x428a2f98UL, 0x71374491UL, 0xb5c0fbcfUL, 0xe9b5dba5UL, 0x3956c25bUL, + 0x59f111f1UL, 0x923f82a4UL, 0xab1c5ed5UL, 0xd807aa98UL, 0x12835b01UL, + 0x243185beUL, 0x550c7dc3UL, 0x72be5d74UL, 0x80deb1feUL, 0x9bdc06a7UL, + 0xc19bf174UL, 0xe49b69c1UL, 0xefbe4786UL, 0x0fc19dc6UL, 0x240ca1ccUL, + 0x2de92c6fUL, 0x4a7484aaUL, 0x5cb0a9dcUL, 0x76f988daUL, 0x983e5152UL, + 0xa831c66dUL, 0xb00327c8UL, 0xbf597fc7UL, 0xc6e00bf3UL, 0xd5a79147UL, + 0x06ca6351UL, 0x14292967UL, 0x27b70a85UL, 0x2e1b2138UL, 0x4d2c6dfcUL, + 0x53380d13UL, 0x650a7354UL, 0x766a0abbUL, 0x81c2c92eUL, 0x92722c85UL, + 0xa2bfe8a1UL, 0xa81a664bUL, 0xc24b8b70UL, 0xc76c51a3UL, 0xd192e819UL, + 0xd6990624UL, 0xf40e3585UL, 0x106aa070UL, 0x19a4c116UL, 0x1e376c08UL, + 0x2748774cUL, 0x34b0bcb5UL, 0x391c0cb3UL, 0x4ed8aa4aUL, 0x5b9cca4fUL, + 0x682e6ff3UL, 0x748f82eeUL, 0x78a5636fUL, 0x84c87814UL, 0x8cc70208UL, + 0x90befffaUL, 0xa4506cebUL, 0xbef9a3f7UL, 0xc67178f2UL +}; +#endif + +/* Various logical functions */ +#define Ch(x,y,z) (z ^ (x & (y ^ z))) +#define Maj(x,y,z) (((x | y) & z) | (x & y)) +#define S(x, n) ROR((x),(n)) +#define R(x, n) (((x)&0xFFFFFFFFUL)>>(n)) +#define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) +#define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) +#define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) +#define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) + +/* compress 512-bits */ +#ifdef CLEAN_STACK +static void _sha256_compress(hash_state * md, unsigned char *buf) +#else +static void sha256_compress(hash_state * md, unsigned char *buf) +#endif +{ + ulong32 S[8], W[64], t0, t1; +#ifdef SMALL_CODE + ulong32 t; +#endif + int i; + + /* copy state into S */ + for (i = 0; i < 8; i++) { + S[i] = md->sha256.state[i]; + } + + /* copy the state into 512-bits into W[0..15] */ + for (i = 0; i < 16; i++) { + LOAD32H(W[i], buf + (4*i)); + } + + /* fill W[16..63] */ + for (i = 16; i < 64; i++) { + W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; + } + + /* Compress */ +#ifdef SMALL_CODE +#define RND(a,b,c,d,e,f,g,h,i) \ + t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ + t1 = Sigma0(a) + Maj(a, b, c); \ + d += t0; \ + h = t0 + t1; + + for (i = 0; i < 64; ++i) { + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i); + t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4]; + S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t; + } +#else +#define RND(a,b,c,d,e,f,g,h,i,ki) \ + t0 = h + Sigma1(e) + Ch(e, f, g) + ki + W[i]; \ + t1 = Sigma0(a) + Maj(a, b, c); \ + d += t0; \ + h = t0 + t1; + + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],0,0x428a2f98); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],1,0x71374491); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],2,0xb5c0fbcf); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],3,0xe9b5dba5); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],4,0x3956c25b); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],5,0x59f111f1); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],6,0x923f82a4); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],7,0xab1c5ed5); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],8,0xd807aa98); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],9,0x12835b01); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],10,0x243185be); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],11,0x550c7dc3); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],12,0x72be5d74); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],13,0x80deb1fe); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],14,0x9bdc06a7); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],15,0xc19bf174); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],16,0xe49b69c1); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],17,0xefbe4786); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],18,0x0fc19dc6); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],19,0x240ca1cc); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],20,0x2de92c6f); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],21,0x4a7484aa); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],22,0x5cb0a9dc); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],23,0x76f988da); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],24,0x983e5152); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],25,0xa831c66d); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],26,0xb00327c8); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],27,0xbf597fc7); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],28,0xc6e00bf3); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],29,0xd5a79147); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],30,0x06ca6351); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],31,0x14292967); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],32,0x27b70a85); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],33,0x2e1b2138); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],34,0x4d2c6dfc); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],35,0x53380d13); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],36,0x650a7354); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],37,0x766a0abb); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],38,0x81c2c92e); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],39,0x92722c85); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],40,0xa2bfe8a1); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],41,0xa81a664b); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],42,0xc24b8b70); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],43,0xc76c51a3); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],44,0xd192e819); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],45,0xd6990624); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],46,0xf40e3585); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],47,0x106aa070); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],48,0x19a4c116); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],49,0x1e376c08); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],50,0x2748774c); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],51,0x34b0bcb5); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],52,0x391c0cb3); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],53,0x4ed8aa4a); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],54,0x5b9cca4f); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],55,0x682e6ff3); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],56,0x748f82ee); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],57,0x78a5636f); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],58,0x84c87814); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],59,0x8cc70208); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],60,0x90befffa); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],61,0xa4506ceb); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],62,0xbef9a3f7); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],63,0xc67178f2); + +#undef RND + +#endif + + /* feedback */ + for (i = 0; i < 8; i++) { + md->sha256.state[i] = md->sha256.state[i] + S[i]; + } + +} + +#ifdef CLEAN_STACK +static void sha256_compress(hash_state * md, unsigned char *buf) +{ + _sha256_compress(md, buf); + burn_stack(sizeof(ulong32) * 74); +} +#endif + +/* init the sha256 state */ +void sha256_init(hash_state * md) +{ + _ARGCHK(md != NULL); + + md->sha256.curlen = 0; + md->sha256.length = 0; + md->sha256.state[0] = 0x6A09E667UL; + md->sha256.state[1] = 0xBB67AE85UL; + md->sha256.state[2] = 0x3C6EF372UL; + md->sha256.state[3] = 0xA54FF53AUL; + md->sha256.state[4] = 0x510E527FUL; + md->sha256.state[5] = 0x9B05688CUL; + md->sha256.state[6] = 0x1F83D9ABUL; + md->sha256.state[7] = 0x5BE0CD19UL; +} + +HASH_PROCESS(sha256_process, sha256_compress, sha256, 64) + +int sha256_done(hash_state * md, unsigned char *hash) +{ + int i; + + _ARGCHK(md != NULL); + _ARGCHK(hash != NULL); + + if (md->sha256.curlen >= sizeof(md->sha256.buf)) { + return CRYPT_INVALID_ARG; + } + + + /* increase the length of the message */ + md->sha256.length += md->sha256.curlen * 8; + + /* append the '1' bit */ + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->sha256.curlen > 56) { + while (md->sha256.curlen < 64) { + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; + } + sha256_compress(md, md->sha256.buf); + md->sha256.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->sha256.curlen < 56) { + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64H(md->sha256.length, md->sha256.buf+56); + sha256_compress(md, md->sha256.buf); + + /* copy output */ + for (i = 0; i < 8; i++) { + STORE32H(md->sha256.state[i], hash+(4*i)); + } +#ifdef CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +int sha256_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char hash[32]; + } tests[] = { + { "abc", + { 0xba, 0x78, 0x16, 0xbf, 0x8f, 0x01, 0xcf, 0xea, + 0x41, 0x41, 0x40, 0xde, 0x5d, 0xae, 0x22, 0x23, + 0xb0, 0x03, 0x61, 0xa3, 0x96, 0x17, 0x7a, 0x9c, + 0xb4, 0x10, 0xff, 0x61, 0xf2, 0x00, 0x15, 0xad } + }, + { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", + { 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8, + 0xe5, 0xc0, 0x26, 0x93, 0x0c, 0x3e, 0x60, 0x39, + 0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67, + 0xf6, 0xec, 0xed, 0xd4, 0x19, 0xdb, 0x06, 0xc1 } + }, + }; + + int i; + unsigned char tmp[32]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha256_init(&md); + sha256_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha256_done(&md, tmp); + if (memcmp(tmp, tests[i].hash, 32) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#ifdef SHA224 +#include "sha224.c" +#endif + +#endif + + diff -r 712dd6dfb0eb -r b939f2d4431e sha384.c --- a/sha384.c Tue Jun 15 14:34:07 2004 +0000 +++ b/sha384.c Tue Jun 15 16:47:55 2004 +0000 @@ -0,0 +1,114 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@iahu.ca, http://libtomcrypt.org + */ + +/* included in sha512.c */ + +const struct _hash_descriptor sha384_desc = +{ + "sha384", + 4, + 48, + 128, + + /* DER identifier */ + { 0x30, 0x41, 0x30, 0x0D, 0x06, 0x09, 0x60, 0x86, + 0x48, 0x01, 0x65, 0x03, 0x04, 0x02, 0x02, 0x05, + 0x00, 0x04, 0x30 }, + 19, + + &sha384_init, + &sha512_process, + &sha384_done, + &sha384_test +}; + +void sha384_init(hash_state * md) +{ + _ARGCHK(md != NULL); + + md->sha512.curlen = 0; + md->sha512.length = 0; + md->sha512.state[0] = CONST64(0xcbbb9d5dc1059ed8); + md->sha512.state[1] = CONST64(0x629a292a367cd507); + md->sha512.state[2] = CONST64(0x9159015a3070dd17); + md->sha512.state[3] = CONST64(0x152fecd8f70e5939); + md->sha512.state[4] = CONST64(0x67332667ffc00b31); + md->sha512.state[5] = CONST64(0x8eb44a8768581511); + md->sha512.state[6] = CONST64(0xdb0c2e0d64f98fa7); + md->sha512.state[7] = CONST64(0x47b5481dbefa4fa4); +} + +int sha384_done(hash_state * md, unsigned char *hash) +{ + unsigned char buf[64]; + + _ARGCHK(md != NULL); + _ARGCHK(hash != NULL); + + if (md->sha512.curlen >= sizeof(md->sha512.buf)) { + return CRYPT_INVALID_ARG; + } + + sha512_done(md, buf); + memcpy(hash, buf, 48); +#ifdef CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + return CRYPT_OK; +} + +int sha384_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char hash[48]; + } tests[] = { + { "abc", + { 0xcb, 0x00, 0x75, 0x3f, 0x45, 0xa3, 0x5e, 0x8b, + 0xb5, 0xa0, 0x3d, 0x69, 0x9a, 0xc6, 0x50, 0x07, + 0x27, 0x2c, 0x32, 0xab, 0x0e, 0xde, 0xd1, 0x63, + 0x1a, 0x8b, 0x60, 0x5a, 0x43, 0xff, 0x5b, 0xed, + 0x80, 0x86, 0x07, 0x2b, 0xa1, 0xe7, 0xcc, 0x23, + 0x58, 0xba, 0xec, 0xa1, 0x34, 0xc8, 0x25, 0xa7 } + }, + { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu", + { 0x09, 0x33, 0x0c, 0x33, 0xf7, 0x11, 0x47, 0xe8, + 0x3d, 0x19, 0x2f, 0xc7, 0x82, 0xcd, 0x1b, 0x47, + 0x53, 0x11, 0x1b, 0x17, 0x3b, 0x3b, 0x05, 0xd2, + 0x2f, 0xa0, 0x80, 0x86, 0xe3, 0xb0, 0xf7, 0x12, + 0xfc, 0xc7, 0xc7, 0x1a, 0x55, 0x7e, 0x2d, 0xb9, + 0x66, 0xc3, 0xe9, 0xfa, 0x91, 0x74, 0x60, 0x39 } + }, + }; + + int i; + unsigned char tmp[48]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha384_init(&md); + sha384_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha384_done(&md, tmp); + if (memcmp(tmp, tests[i].hash, 48) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + + + + + diff -r 712dd6dfb0eb -r b939f2d4431e sha512.c --- a/sha512.c Tue Jun 15 14:34:07 2004 +0000 +++ b/sha512.c Tue Jun 15 16:47:55 2004 +0000 @@ -0,0 +1,289 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@iahu.ca, http://libtomcrypt.org + */ + +/* SHA512 by Tom St Denis */ + +#include "mycrypt.h" + +#ifdef SHA512 + +const struct _hash_descriptor sha512_desc = +{ + "sha512", + 5, + 64, + 128, + + /* DER identifier */ + { 0x30, 0x51, 0x30, 0x0D, 0x06, 0x09, 0x60, 0x86, + 0x48, 0x01, 0x65, 0x03, 0x04, 0x02, 0x03, 0x05, + 0x00, 0x04, 0x40 }, + 19, + + &sha512_init, + &sha512_process, + &sha512_done, + &sha512_test +}; + +/* the K array */ +static const ulong64 K[80] = { +CONST64(0x428a2f98d728ae22), CONST64(0x7137449123ef65cd), +CONST64(0xb5c0fbcfec4d3b2f), CONST64(0xe9b5dba58189dbbc), +CONST64(0x3956c25bf348b538), CONST64(0x59f111f1b605d019), +CONST64(0x923f82a4af194f9b), CONST64(0xab1c5ed5da6d8118), +CONST64(0xd807aa98a3030242), CONST64(0x12835b0145706fbe), +CONST64(0x243185be4ee4b28c), CONST64(0x550c7dc3d5ffb4e2), +CONST64(0x72be5d74f27b896f), CONST64(0x80deb1fe3b1696b1), +CONST64(0x9bdc06a725c71235), CONST64(0xc19bf174cf692694), +CONST64(0xe49b69c19ef14ad2), CONST64(0xefbe4786384f25e3), +CONST64(0x0fc19dc68b8cd5b5), CONST64(0x240ca1cc77ac9c65), +CONST64(0x2de92c6f592b0275), CONST64(0x4a7484aa6ea6e483), +CONST64(0x5cb0a9dcbd41fbd4), CONST64(0x76f988da831153b5), +CONST64(0x983e5152ee66dfab), CONST64(0xa831c66d2db43210), +CONST64(0xb00327c898fb213f), CONST64(0xbf597fc7beef0ee4), +CONST64(0xc6e00bf33da88fc2), CONST64(0xd5a79147930aa725), +CONST64(0x06ca6351e003826f), CONST64(0x142929670a0e6e70), +CONST64(0x27b70a8546d22ffc), CONST64(0x2e1b21385c26c926), +CONST64(0x4d2c6dfc5ac42aed), CONST64(0x53380d139d95b3df), +CONST64(0x650a73548baf63de), CONST64(0x766a0abb3c77b2a8), +CONST64(0x81c2c92e47edaee6), CONST64(0x92722c851482353b), +CONST64(0xa2bfe8a14cf10364), CONST64(0xa81a664bbc423001), +CONST64(0xc24b8b70d0f89791), CONST64(0xc76c51a30654be30), +CONST64(0xd192e819d6ef5218), CONST64(0xd69906245565a910), +CONST64(0xf40e35855771202a), CONST64(0x106aa07032bbd1b8), +CONST64(0x19a4c116b8d2d0c8), CONST64(0x1e376c085141ab53), +CONST64(0x2748774cdf8eeb99), CONST64(0x34b0bcb5e19b48a8), +CONST64(0x391c0cb3c5c95a63), CONST64(0x4ed8aa4ae3418acb), +CONST64(0x5b9cca4f7763e373), CONST64(0x682e6ff3d6b2b8a3), +CONST64(0x748f82ee5defb2fc), CONST64(0x78a5636f43172f60), +CONST64(0x84c87814a1f0ab72), CONST64(0x8cc702081a6439ec), +CONST64(0x90befffa23631e28), CONST64(0xa4506cebde82bde9), +CONST64(0xbef9a3f7b2c67915), CONST64(0xc67178f2e372532b), +CONST64(0xca273eceea26619c), CONST64(0xd186b8c721c0c207), +CONST64(0xeada7dd6cde0eb1e), CONST64(0xf57d4f7fee6ed178), +CONST64(0x06f067aa72176fba), CONST64(0x0a637dc5a2c898a6), +CONST64(0x113f9804bef90dae), CONST64(0x1b710b35131c471b), +CONST64(0x28db77f523047d84), CONST64(0x32caab7b40c72493), +CONST64(0x3c9ebe0a15c9bebc), CONST64(0x431d67c49c100d4c), +CONST64(0x4cc5d4becb3e42b6), CONST64(0x597f299cfc657e2a), +CONST64(0x5fcb6fab3ad6faec), CONST64(0x6c44198c4a475817) +}; + +/* Various logical functions */ +#define Ch(x,y,z) (z ^ (x & (y ^ z))) +#define Maj(x,y,z) (((x | y) & z) | (x & y)) +#define S(x, n) ROR64((x),(n)) +#define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n)) +#define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) +#define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) +#define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) +#define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) + +/* compress 1024-bits */ +#ifdef CLEAN_STACK +static void _sha512_compress(hash_state * md, unsigned char *buf) +#else +static void sha512_compress(hash_state * md, unsigned char *buf) +#endif +{ + ulong64 S[8], W[80], t0, t1; + int i; + + /* copy state into S */ + for (i = 0; i < 8; i++) { + S[i] = md->sha512.state[i]; + } + + /* copy the state into 1024-bits into W[0..15] */ + for (i = 0; i < 16; i++) { + LOAD64H(W[i], buf + (8*i)); + } + + /* fill W[16..79] */ + for (i = 16; i < 80; i++) { + W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; + } + + /* Compress */ +#ifdef SMALL_CODE + for (i = 0; i < 80; i++) { + t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i]; + t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]); + S[7] = S[6]; + S[6] = S[5]; + S[5] = S[4]; + S[4] = S[3] + t0; + S[3] = S[2]; + S[2] = S[1]; + S[1] = S[0]; + S[0] = t0 + t1; + } +#else +#define RND(a,b,c,d,e,f,g,h,i) \ + t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ + t1 = Sigma0(a) + Maj(a, b, c); \ + d += t0; \ + h = t0 + t1; + + for (i = 0; i < 80; i += 8) { + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7); + } +#endif + + + /* feedback */ + for (i = 0; i < 8; i++) { + md->sha512.state[i] = md->sha512.state[i] + S[i]; + } +} + +/* compress 1024-bits */ +#ifdef CLEAN_STACK +static void sha512_compress(hash_state * md, unsigned char *buf) +{ + _sha512_compress(md, buf); + burn_stack(sizeof(ulong64) * 90 + sizeof(int)); +} +#endif + +/* init the sha512 state */ +void sha512_init(hash_state * md) +{ + _ARGCHK(md != NULL); + + md->sha512.curlen = 0; + md->sha512.length = 0; + md->sha512.state[0] = CONST64(0x6a09e667f3bcc908); + md->sha512.state[1] = CONST64(0xbb67ae8584caa73b); + md->sha512.state[2] = CONST64(0x3c6ef372fe94f82b); + md->sha512.state[3] = CONST64(0xa54ff53a5f1d36f1); + md->sha512.state[4] = CONST64(0x510e527fade682d1); + md->sha512.state[5] = CONST64(0x9b05688c2b3e6c1f); + md->sha512.state[6] = CONST64(0x1f83d9abfb41bd6b); + md->sha512.state[7] = CONST64(0x5be0cd19137e2179); +} + +HASH_PROCESS(sha512_process, sha512_compress, sha512, 128) + +int sha512_done(hash_state * md, unsigned char *hash) +{ + int i; + + _ARGCHK(md != NULL); + _ARGCHK(hash != NULL); + + if (md->sha512.curlen >= sizeof(md->sha512.buf)) { + return CRYPT_INVALID_ARG; + } + + /* increase the length of the message */ + md->sha512.length += md->sha512.curlen * CONST64(8); + + /* append the '1' bit */ + md->sha512.buf[md->sha512.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 112 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->sha512.curlen > 112) { + while (md->sha512.curlen < 128) { + md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; + } + sha512_compress(md, md->sha512.buf); + md->sha512.curlen = 0; + } + + /* pad upto 120 bytes of zeroes + * note: that from 112 to 120 is the 64 MSB of the length. We assume that you won't hash + * > 2^64 bits of data... :-) + */ + while (md->sha512.curlen < 120) { + md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64H(md->sha512.length, md->sha512.buf+120); + sha512_compress(md, md->sha512.buf); + + /* copy output */ + for (i = 0; i < 8; i++) { + STORE64H(md->sha512.state[i], hash+(8*i)); + } +#ifdef CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +int sha512_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char hash[64]; + } tests[] = { + { "abc", + { 0xdd, 0xaf, 0x35, 0xa1, 0x93, 0x61, 0x7a, 0xba, + 0xcc, 0x41, 0x73, 0x49, 0xae, 0x20, 0x41, 0x31, + 0x12, 0xe6, 0xfa, 0x4e, 0x89, 0xa9, 0x7e, 0xa2, + 0x0a, 0x9e, 0xee, 0xe6, 0x4b, 0x55, 0xd3, 0x9a, + 0x21, 0x92, 0x99, 0x2a, 0x27, 0x4f, 0xc1, 0xa8, + 0x36, 0xba, 0x3c, 0x23, 0xa3, 0xfe, 0xeb, 0xbd, + 0x45, 0x4d, 0x44, 0x23, 0x64, 0x3c, 0xe8, 0x0e, + 0x2a, 0x9a, 0xc9, 0x4f, 0xa5, 0x4c, 0xa4, 0x9f } + }, + { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu", + { 0x8e, 0x95, 0x9b, 0x75, 0xda, 0xe3, 0x13, 0xda, + 0x8c, 0xf4, 0xf7, 0x28, 0x14, 0xfc, 0x14, 0x3f, + 0x8f, 0x77, 0x79, 0xc6, 0xeb, 0x9f, 0x7f, 0xa1, + 0x72, 0x99, 0xae, 0xad, 0xb6, 0x88, 0x90, 0x18, + 0x50, 0x1d, 0x28, 0x9e, 0x49, 0x00, 0xf7, 0xe4, + 0x33, 0x1b, 0x99, 0xde, 0xc4, 0xb5, 0x43, 0x3a, + 0xc7, 0xd3, 0x29, 0xee, 0xb6, 0xdd, 0x26, 0x54, + 0x5e, 0x96, 0xe5, 0x5b, 0x87, 0x4b, 0xe9, 0x09 } + }, + }; + + int i; + unsigned char tmp[64]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha512_init(&md); + sha512_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha512_done(&md, tmp); + if (memcmp(tmp, tests[i].hash, 64) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#ifdef SHA384 + #include "sha384.c" +#endif + +#endif + + + diff -r 712dd6dfb0eb -r b939f2d4431e tiger.c --- a/tiger.c Tue Jun 15 14:34:07 2004 +0000 +++ b/tiger.c Tue Jun 15 16:47:55 2004 +0000 @@ -0,0 +1,779 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@iahu.ca, http://libtomcrypt.org + */ + +#include "mycrypt.h" + +#ifdef TIGER + +const struct _hash_descriptor tiger_desc = +{ + "tiger", + 1, + 24, + 64, + + /* DER identifier */ + { 0x30, 0x29, 0x30, 0x0D, 0x06, 0x09, 0x2B, 0x06, + 0x01, 0x04, 0x01, 0xDA, 0x47, 0x0C, 0x02, 0x05, + 0x00, 0x04, 0x18 }, + 19, + + &tiger_init, + &tiger_process, + &tiger_done, + &tiger_test +}; + +#define t1 (table) +#define t2 (table+256) +#define t3 (table+256*2) +#define t4 (table+256*3) + +static const ulong64 table[4*256] = { + CONST64(0x02AAB17CF7E90C5E) /* 0 */, CONST64(0xAC424B03E243A8EC) /* 1 */, + CONST64(0x72CD5BE30DD5FCD3) /* 2 */, CONST64(0x6D019B93F6F97F3A) /* 3 */, + CONST64(0xCD9978FFD21F9193) /* 4 */, CONST64(0x7573A1C9708029E2) /* 5 */, + CONST64(0xB164326B922A83C3) /* 6 */, CONST64(0x46883EEE04915870) /* 7 */, + CONST64(0xEAACE3057103ECE6) /* 8 */, CONST64(0xC54169B808A3535C) /* 9 */, + CONST64(0x4CE754918DDEC47C) /* 10 */, CONST64(0x0AA2F4DFDC0DF40C) /* 11 */, + CONST64(0x10B76F18A74DBEFA) /* 12 */, CONST64(0xC6CCB6235AD1AB6A) /* 13 */, + CONST64(0x13726121572FE2FF) /* 14 */, CONST64(0x1A488C6F199D921E) /* 15 */, + CONST64(0x4BC9F9F4DA0007CA) /* 16 */, CONST64(0x26F5E6F6E85241C7) /* 17 */, + CONST64(0x859079DBEA5947B6) /* 18 */, CONST64(0x4F1885C5C99E8C92) /* 19 */, + CONST64(0xD78E761EA96F864B) /* 20 */, CONST64(0x8E36428C52B5C17D) /* 21 */, + CONST64(0x69CF6827373063C1) /* 22 */, CONST64(0xB607C93D9BB4C56E) /* 23 */, + CONST64(0x7D820E760E76B5EA) /* 24 */, CONST64(0x645C9CC6F07FDC42) /* 25 */, + CONST64(0xBF38A078243342E0) /* 26 */, CONST64(0x5F6B343C9D2E7D04) /* 27 */, + CONST64(0xF2C28AEB600B0EC6) /* 28 */, CONST64(0x6C0ED85F7254BCAC) /* 29 */, + CONST64(0x71592281A4DB4FE5) /* 30 */, CONST64(0x1967FA69CE0FED9F) /* 31 */, + CONST64(0xFD5293F8B96545DB) /* 32 */, CONST64(0xC879E9D7F2A7600B) /* 33 */, + CONST64(0x860248920193194E) /* 34 */, CONST64(0xA4F9533B2D9CC0B3) /* 35 */, + CONST64(0x9053836C15957613) /* 36 */, CONST64(0xDB6DCF8AFC357BF1) /* 37 */, + CONST64(0x18BEEA7A7A370F57) /* 38 */, CONST64(0x037117CA50B99066) /* 39 */, + CONST64(0x6AB30A9774424A35) /* 40 */, CONST64(0xF4E92F02E325249B) /* 41 */, + CONST64(0x7739DB07061CCAE1) /* 42 */, CONST64(0xD8F3B49CECA42A05) /* 43 */, + CONST64(0xBD56BE3F51382F73) /* 44 */, CONST64(0x45FAED5843B0BB28) /* 45 */, + CONST64(0x1C813D5C11BF1F83) /* 46 */, CONST64(0x8AF0E4B6D75FA169) /* 47 */, + CONST64(0x33EE18A487AD9999) /* 48 */, CONST64(0x3C26E8EAB1C94410) /* 49 */, + CONST64(0xB510102BC0A822F9) /* 50 */, CONST64(0x141EEF310CE6123B) /* 51 */, + CONST64(0xFC65B90059DDB154) /* 52 */, CONST64(0xE0158640C5E0E607) /* 53 */, + CONST64(0x884E079826C3A3CF) /* 54 */, CONST64(0x930D0D9523C535FD) /* 55 */, + CONST64(0x35638D754E9A2B00) /* 56 */, CONST64(0x4085FCCF40469DD5) /* 57 */, + CONST64(0xC4B17AD28BE23A4C) /* 58 */, CONST64(0xCAB2F0FC6A3E6A2E) /* 59 */, + CONST64(0x2860971A6B943FCD) /* 60 */, CONST64(0x3DDE6EE212E30446) /* 61 */, + CONST64(0x6222F32AE01765AE) /* 62 */, CONST64(0x5D550BB5478308FE) /* 63 */, + CONST64(0xA9EFA98DA0EDA22A) /* 64 */, CONST64(0xC351A71686C40DA7) /* 65 */, + CONST64(0x1105586D9C867C84) /* 66 */, CONST64(0xDCFFEE85FDA22853) /* 67 */, + CONST64(0xCCFBD0262C5EEF76) /* 68 */, CONST64(0xBAF294CB8990D201) /* 69 */, + CONST64(0xE69464F52AFAD975) /* 70 */, CONST64(0x94B013AFDF133E14) /* 71 */, + CONST64(0x06A7D1A32823C958) /* 72 */, CONST64(0x6F95FE5130F61119) /* 73 */, + CONST64(0xD92AB34E462C06C0) /* 74 */, CONST64(0xED7BDE33887C71D2) /* 75 */, + CONST64(0x79746D6E6518393E) /* 76 */, CONST64(0x5BA419385D713329) /* 77 */, + CONST64(0x7C1BA6B948A97564) /* 78 */, CONST64(0x31987C197BFDAC67) /* 79 */, + CONST64(0xDE6C23C44B053D02) /* 80 */, CONST64(0x581C49FED002D64D) /* 81 */, + CONST64(0xDD474D6338261571) /* 82 */, CONST64(0xAA4546C3E473D062) /* 83 */, + CONST64(0x928FCE349455F860) /* 84 */, CONST64(0x48161BBACAAB94D9) /* 85 */, + CONST64(0x63912430770E6F68) /* 86 */, CONST64(0x6EC8A5E602C6641C) /* 87 */, + CONST64(0x87282515337DDD2B) /* 88 */, CONST64(0x2CDA6B42034B701B) /* 89 */, + CONST64(0xB03D37C181CB096D) /* 90 */, CONST64(0xE108438266C71C6F) /* 91 */, + CONST64(0x2B3180C7EB51B255) /* 92 */, CONST64(0xDF92B82F96C08BBC) /* 93 */, + CONST64(0x5C68C8C0A632F3BA) /* 94 */, CONST64(0x5504CC861C3D0556) /* 95 */, + CONST64(0xABBFA4E55FB26B8F) /* 96 */, CONST64(0x41848B0AB3BACEB4) /* 97 */, + CONST64(0xB334A273AA445D32) /* 98 */, CONST64(0xBCA696F0A85AD881) /* 99 */, + CONST64(0x24F6EC65B528D56C) /* 100 */, CONST64(0x0CE1512E90F4524A) /* 101 */, + CONST64(0x4E9DD79D5506D35A) /* 102 */, CONST64(0x258905FAC6CE9779) /* 103 */, + CONST64(0x2019295B3E109B33) /* 104 */, CONST64(0xF8A9478B73A054CC) /* 105 */, + CONST64(0x2924F2F934417EB0) /* 106 */, CONST64(0x3993357D536D1BC4) /* 107 */, + CONST64(0x38A81AC21DB6FF8B) /* 108 */, CONST64(0x47C4FBF17D6016BF) /* 109 */, + CONST64(0x1E0FAADD7667E3F5) /* 110 */, CONST64(0x7ABCFF62938BEB96) /* 111 */, + CONST64(0xA78DAD948FC179C9) /* 112 */, CONST64(0x8F1F98B72911E50D) /* 113 */, + CONST64(0x61E48EAE27121A91) /* 114 */, CONST64(0x4D62F7AD31859808) /* 115 */, + CONST64(0xECEBA345EF5CEAEB) /* 116 */, CONST64(0xF5CEB25EBC9684CE) /* 117 */, + CONST64(0xF633E20CB7F76221) /* 118 */, CONST64(0xA32CDF06AB8293E4) /* 119 */, + CONST64(0x985A202CA5EE2CA4) /* 120 */, CONST64(0xCF0B8447CC8A8FB1) /* 121 */, + CONST64(0x9F765244979859A3) /* 122 */, CONST64(0xA8D516B1A1240017) /* 123 */, + CONST64(0x0BD7BA3EBB5DC726) /* 124 */, CONST64(0xE54BCA55B86ADB39) /* 125 */, + CONST64(0x1D7A3AFD6C478063) /* 126 */, CONST64(0x519EC608E7669EDD) /* 127 */, + CONST64(0x0E5715A2D149AA23) /* 128 */, CONST64(0x177D4571848FF194) /* 129 */, + CONST64(0xEEB55F3241014C22) /* 130 */, CONST64(0x0F5E5CA13A6E2EC2) /* 131 */, + CONST64(0x8029927B75F5C361) /* 132 */, CONST64(0xAD139FABC3D6E436) /* 133 */, + CONST64(0x0D5DF1A94CCF402F) /* 134 */, CONST64(0x3E8BD948BEA5DFC8) /* 135 */, + CONST64(0xA5A0D357BD3FF77E) /* 136 */, CONST64(0xA2D12E251F74F645) /* 137 */, + CONST64(0x66FD9E525E81A082) /* 138 */, CONST64(0x2E0C90CE7F687A49) /* 139 */, + CONST64(0xC2E8BCBEBA973BC5) /* 140 */, CONST64(0x000001BCE509745F) /* 141 */, + CONST64(0x423777BBE6DAB3D6) /* 142 */, CONST64(0xD1661C7EAEF06EB5) /* 143 */, + CONST64(0xA1781F354DAACFD8) /* 144 */, CONST64(0x2D11284A2B16AFFC) /* 145 */, + CONST64(0xF1FC4F67FA891D1F) /* 146 */, CONST64(0x73ECC25DCB920ADA) /* 147 */, + CONST64(0xAE610C22C2A12651) /* 148 */, CONST64(0x96E0A810D356B78A) /* 149 */, + CONST64(0x5A9A381F2FE7870F) /* 150 */, CONST64(0xD5AD62EDE94E5530) /* 151 */, + CONST64(0xD225E5E8368D1427) /* 152 */, CONST64(0x65977B70C7AF4631) /* 153 */, + CONST64(0x99F889B2DE39D74F) /* 154 */, CONST64(0x233F30BF54E1D143) /* 155 */, + CONST64(0x9A9675D3D9A63C97) /* 156 */, CONST64(0x5470554FF334F9A8) /* 157 */, + CONST64(0x166ACB744A4F5688) /* 158 */, CONST64(0x70C74CAAB2E4AEAD) /* 159 */, + CONST64(0xF0D091646F294D12) /* 160 */, CONST64(0x57B82A89684031D1) /* 161 */, + CONST64(0xEFD95A5A61BE0B6B) /* 162 */, CONST64(0x2FBD12E969F2F29A) /* 163 */, + CONST64(0x9BD37013FEFF9FE8) /* 164 */, CONST64(0x3F9B0404D6085A06) /* 165 */, + CONST64(0x4940C1F3166CFE15) /* 166 */, CONST64(0x09542C4DCDF3DEFB) /* 167 */, + CONST64(0xB4C5218385CD5CE3) /* 168 */, CONST64(0xC935B7DC4462A641) /* 169 */, + CONST64(0x3417F8A68ED3B63F) /* 170 */, CONST64(0xB80959295B215B40) /* 171 */, + CONST64(0xF99CDAEF3B8C8572) /* 172 */, CONST64(0x018C0614F8FCB95D) /* 173 */, + CONST64(0x1B14ACCD1A3ACDF3) /* 174 */, CONST64(0x84D471F200BB732D) /* 175 */, + CONST64(0xC1A3110E95E8DA16) /* 176 */, CONST64(0x430A7220BF1A82B8) /* 177 */, + CONST64(0xB77E090D39DF210E) /* 178 */, CONST64(0x5EF4BD9F3CD05E9D) /* 179 */, + CONST64(0x9D4FF6DA7E57A444) /* 180 */, CONST64(0xDA1D60E183D4A5F8) /* 181 */, + CONST64(0xB287C38417998E47) /* 182 */, CONST64(0xFE3EDC121BB31886) /* 183 */, + CONST64(0xC7FE3CCC980CCBEF) /* 184 */, CONST64(0xE46FB590189BFD03) /* 185 */, + CONST64(0x3732FD469A4C57DC) /* 186 */, CONST64(0x7EF700A07CF1AD65) /* 187 */, + CONST64(0x59C64468A31D8859) /* 188 */, CONST64(0x762FB0B4D45B61F6) /* 189 */, + CONST64(0x155BAED099047718) /* 190 */, CONST64(0x68755E4C3D50BAA6) /* 191 */, + CONST64(0xE9214E7F22D8B4DF) /* 192 */, CONST64(0x2ADDBF532EAC95F4) /* 193 */, + CONST64(0x32AE3909B4BD0109) /* 194 */, CONST64(0x834DF537B08E3450) /* 195 */, + CONST64(0xFA209DA84220728D) /* 196 */, CONST64(0x9E691D9B9EFE23F7) /* 197 */, + CONST64(0x0446D288C4AE8D7F) /* 198 */, CONST64(0x7B4CC524E169785B) /* 199 */, + CONST64(0x21D87F0135CA1385) /* 200 */, CONST64(0xCEBB400F137B8AA5) /* 201 */, + CONST64(0x272E2B66580796BE) /* 202 */, CONST64(0x3612264125C2B0DE) /* 203 */, + CONST64(0x057702BDAD1EFBB2) /* 204 */, CONST64(0xD4BABB8EACF84BE9) /* 205 */, + CONST64(0x91583139641BC67B) /* 206 */, CONST64(0x8BDC2DE08036E024) /* 207 */, + CONST64(0x603C8156F49F68ED) /* 208 */, CONST64(0xF7D236F7DBEF5111) /* 209 */, + CONST64(0x9727C4598AD21E80) /* 210 */, CONST64(0xA08A0896670A5FD7) /* 211 */, + CONST64(0xCB4A8F4309EBA9CB) /* 212 */, CONST64(0x81AF564B0F7036A1) /* 213 */, + CONST64(0xC0B99AA778199ABD) /* 214 */, CONST64(0x959F1EC83FC8E952) /* 215 */, + CONST64(0x8C505077794A81B9) /* 216 */, CONST64(0x3ACAAF8F056338F0) /* 217 */, + CONST64(0x07B43F50627A6778) /* 218 */, CONST64(0x4A44AB49F5ECCC77) /* 219 */, + CONST64(0x3BC3D6E4B679EE98) /* 220 */, CONST64(0x9CC0D4D1CF14108C) /* 221 */, + CONST64(0x4406C00B206BC8A0) /* 222 */, CONST64(0x82A18854C8D72D89) /* 223 */, + CONST64(0x67E366B35C3C432C) /* 224 */, CONST64(0xB923DD61102B37F2) /* 225 */, + CONST64(0x56AB2779D884271D) /* 226 */, CONST64(0xBE83E1B0FF1525AF) /* 227 */, + CONST64(0xFB7C65D4217E49A9) /* 228 */, CONST64(0x6BDBE0E76D48E7D4) /* 229 */, + CONST64(0x08DF828745D9179E) /* 230 */, CONST64(0x22EA6A9ADD53BD34) /* 231 */, + CONST64(0xE36E141C5622200A) /* 232 */, CONST64(0x7F805D1B8CB750EE) /* 233 */, + CONST64(0xAFE5C7A59F58E837) /* 234 */, CONST64(0xE27F996A4FB1C23C) /* 235 */, + CONST64(0xD3867DFB0775F0D0) /* 236 */, CONST64(0xD0E673DE6E88891A) /* 237 */, + CONST64(0x123AEB9EAFB86C25) /* 238 */, CONST64(0x30F1D5D5C145B895) /* 239 */, + CONST64(0xBB434A2DEE7269E7) /* 240 */, CONST64(0x78CB67ECF931FA38) /* 241 */, + CONST64(0xF33B0372323BBF9C) /* 242 */, CONST64(0x52D66336FB279C74) /* 243 */, + CONST64(0x505F33AC0AFB4EAA) /* 244 */, CONST64(0xE8A5CD99A2CCE187) /* 245 */, + CONST64(0x534974801E2D30BB) /* 246 */, CONST64(0x8D2D5711D5876D90) /* 247 */, + CONST64(0x1F1A412891BC038E) /* 248 */, CONST64(0xD6E2E71D82E56648) /* 249 */, + CONST64(0x74036C3A497732B7) /* 250 */, CONST64(0x89B67ED96361F5AB) /* 251 */, + CONST64(0xFFED95D8F1EA02A2) /* 252 */, CONST64(0xE72B3BD61464D43D) /* 253 */, + CONST64(0xA6300F170BDC4820) /* 254 */, CONST64(0xEBC18760ED78A77A) /* 255 */, + CONST64(0xE6A6BE5A05A12138) /* 256 */, CONST64(0xB5A122A5B4F87C98) /* 257 */, + CONST64(0x563C6089140B6990) /* 258 */, CONST64(0x4C46CB2E391F5DD5) /* 259 */, + CONST64(0xD932ADDBC9B79434) /* 260 */, CONST64(0x08EA70E42015AFF5) /* 261 */, + CONST64(0xD765A6673E478CF1) /* 262 */, CONST64(0xC4FB757EAB278D99) /* 263 */, + CONST64(0xDF11C6862D6E0692) /* 264 */, CONST64(0xDDEB84F10D7F3B16) /* 265 */, + CONST64(0x6F2EF604A665EA04) /* 266 */, CONST64(0x4A8E0F0FF0E0DFB3) /* 267 */, + CONST64(0xA5EDEEF83DBCBA51) /* 268 */, CONST64(0xFC4F0A2A0EA4371E) /* 269 */, + CONST64(0xE83E1DA85CB38429) /* 270 */, CONST64(0xDC8FF882BA1B1CE2) /* 271 */, + CONST64(0xCD45505E8353E80D) /* 272 */, CONST64(0x18D19A00D4DB0717) /* 273 */, + CONST64(0x34A0CFEDA5F38101) /* 274 */, CONST64(0x0BE77E518887CAF2) /* 275 */, + CONST64(0x1E341438B3C45136) /* 276 */, CONST64(0xE05797F49089CCF9) /* 277 */, + CONST64(0xFFD23F9DF2591D14) /* 278 */, CONST64(0x543DDA228595C5CD) /* 279 */, + CONST64(0x661F81FD99052A33) /* 280 */, CONST64(0x8736E641DB0F7B76) /* 281 */, + CONST64(0x15227725418E5307) /* 282 */, CONST64(0xE25F7F46162EB2FA) /* 283 */, + CONST64(0x48A8B2126C13D9FE) /* 284 */, CONST64(0xAFDC541792E76EEA) /* 285 */, + CONST64(0x03D912BFC6D1898F) /* 286 */, CONST64(0x31B1AAFA1B83F51B) /* 287 */, + CONST64(0xF1AC2796E42AB7D9) /* 288 */, CONST64(0x40A3A7D7FCD2EBAC) /* 289 */, + CONST64(0x1056136D0AFBBCC5) /* 290 */, CONST64(0x7889E1DD9A6D0C85) /* 291 */, + CONST64(0xD33525782A7974AA) /* 292 */, CONST64(0xA7E25D09078AC09B) /* 293 */, + CONST64(0xBD4138B3EAC6EDD0) /* 294 */, CONST64(0x920ABFBE71EB9E70) /* 295 */, + CONST64(0xA2A5D0F54FC2625C) /* 296 */, CONST64(0xC054E36B0B1290A3) /* 297 */, + CONST64(0xF6DD59FF62FE932B) /* 298 */, CONST64(0x3537354511A8AC7D) /* 299 */, + CONST64(0xCA845E9172FADCD4) /* 300 */, CONST64(0x84F82B60329D20DC) /* 301 */, + CONST64(0x79C62CE1CD672F18) /* 302 */, CONST64(0x8B09A2ADD124642C) /* 303 */, + CONST64(0xD0C1E96A19D9E726) /* 304 */, CONST64(0x5A786A9B4BA9500C) /* 305 */, + CONST64(0x0E020336634C43F3) /* 306 */, CONST64(0xC17B474AEB66D822) /* 307 */, + CONST64(0x6A731AE3EC9BAAC2) /* 308 */, CONST64(0x8226667AE0840258) /* 309 */, + CONST64(0x67D4567691CAECA5) /* 310 */, CONST64(0x1D94155C4875ADB5) /* 311 */, + CONST64(0x6D00FD985B813FDF) /* 312 */, CONST64(0x51286EFCB774CD06) /* 313 */, + CONST64(0x5E8834471FA744AF) /* 314 */, CONST64(0xF72CA0AEE761AE2E) /* 315 */, + CONST64(0xBE40E4CDAEE8E09A) /* 316 */, CONST64(0xE9970BBB5118F665) /* 317 */, + CONST64(0x726E4BEB33DF1964) /* 318 */, CONST64(0x703B000729199762) /* 319 */, + CONST64(0x4631D816F5EF30A7) /* 320 */, CONST64(0xB880B5B51504A6BE) /* 321 */, + CONST64(0x641793C37ED84B6C) /* 322 */, CONST64(0x7B21ED77F6E97D96) /* 323 */, + CONST64(0x776306312EF96B73) /* 324 */, CONST64(0xAE528948E86FF3F4) /* 325 */, + CONST64(0x53DBD7F286A3F8F8) /* 326 */, CONST64(0x16CADCE74CFC1063) /* 327 */, + CONST64(0x005C19BDFA52C6DD) /* 328 */, CONST64(0x68868F5D64D46AD3) /* 329 */, + CONST64(0x3A9D512CCF1E186A) /* 330 */, CONST64(0x367E62C2385660AE) /* 331 */, + CONST64(0xE359E7EA77DCB1D7) /* 332 */, CONST64(0x526C0773749ABE6E) /* 333 */, + CONST64(0x735AE5F9D09F734B) /* 334 */, CONST64(0x493FC7CC8A558BA8) /* 335 */, + CONST64(0xB0B9C1533041AB45) /* 336 */, CONST64(0x321958BA470A59BD) /* 337 */, + CONST64(0x852DB00B5F46C393) /* 338 */, CONST64(0x91209B2BD336B0E5) /* 339 */, + CONST64(0x6E604F7D659EF19F) /* 340 */, CONST64(0xB99A8AE2782CCB24) /* 341 */, + CONST64(0xCCF52AB6C814C4C7) /* 342 */, CONST64(0x4727D9AFBE11727B) /* 343 */, + CONST64(0x7E950D0C0121B34D) /* 344 */, CONST64(0x756F435670AD471F) /* 345 */, + CONST64(0xF5ADD442615A6849) /* 346 */, CONST64(0x4E87E09980B9957A) /* 347 */, + CONST64(0x2ACFA1DF50AEE355) /* 348 */, CONST64(0xD898263AFD2FD556) /* 349 */, + CONST64(0xC8F4924DD80C8FD6) /* 350 */, CONST64(0xCF99CA3D754A173A) /* 351 */, + CONST64(0xFE477BACAF91BF3C) /* 352 */, CONST64(0xED5371F6D690C12D) /* 353 */, + CONST64(0x831A5C285E687094) /* 354 */, CONST64(0xC5D3C90A3708A0A4) /* 355 */, + CONST64(0x0F7F903717D06580) /* 356 */, CONST64(0x19F9BB13B8FDF27F) /* 357 */, + CONST64(0xB1BD6F1B4D502843) /* 358 */, CONST64(0x1C761BA38FFF4012) /* 359 */, + CONST64(0x0D1530C4E2E21F3B) /* 360 */, CONST64(0x8943CE69A7372C8A) /* 361 */, + CONST64(0xE5184E11FEB5CE66) /* 362 */, CONST64(0x618BDB80BD736621) /* 363 */, + CONST64(0x7D29BAD68B574D0B) /* 364 */, CONST64(0x81BB613E25E6FE5B) /* 365 */, + CONST64(0x071C9C10BC07913F) /* 366 */, CONST64(0xC7BEEB7909AC2D97) /* 367 */, + CONST64(0xC3E58D353BC5D757) /* 368 */, CONST64(0xEB017892F38F61E8) /* 369 */, + CONST64(0xD4EFFB9C9B1CC21A) /* 370 */, CONST64(0x99727D26F494F7AB) /* 371 */, + CONST64(0xA3E063A2956B3E03) /* 372 */, CONST64(0x9D4A8B9A4AA09C30) /* 373 */, + CONST64(0x3F6AB7D500090FB4) /* 374 */, CONST64(0x9CC0F2A057268AC0) /* 375 */, + CONST64(0x3DEE9D2DEDBF42D1) /* 376 */, CONST64(0x330F49C87960A972) /* 377 */, + CONST64(0xC6B2720287421B41) /* 378 */, CONST64(0x0AC59EC07C00369C) /* 379 */, + CONST64(0xEF4EAC49CB353425) /* 380 */, CONST64(0xF450244EEF0129D8) /* 381 */, + CONST64(0x8ACC46E5CAF4DEB6) /* 382 */, CONST64(0x2FFEAB63989263F7) /* 383 */, + CONST64(0x8F7CB9FE5D7A4578) /* 384 */, CONST64(0x5BD8F7644E634635) /* 385 */, + CONST64(0x427A7315BF2DC900) /* 386 */, CONST64(0x17D0C4AA2125261C) /* 387 */, + CONST64(0x3992486C93518E50) /* 388 */, CONST64(0xB4CBFEE0A2D7D4C3) /* 389 */, + CONST64(0x7C75D6202C5DDD8D) /* 390 */, CONST64(0xDBC295D8E35B6C61) /* 391 */, + CONST64(0x60B369D302032B19) /* 392 */, CONST64(0xCE42685FDCE44132) /* 393 */, + CONST64(0x06F3DDB9DDF65610) /* 394 */, CONST64(0x8EA4D21DB5E148F0) /* 395 */, + CONST64(0x20B0FCE62FCD496F) /* 396 */, CONST64(0x2C1B912358B0EE31) /* 397 */, + CONST64(0xB28317B818F5A308) /* 398 */, CONST64(0xA89C1E189CA6D2CF) /* 399 */, + CONST64(0x0C6B18576AAADBC8) /* 400 */, CONST64(0xB65DEAA91299FAE3) /* 401 */, + CONST64(0xFB2B794B7F1027E7) /* 402 */, CONST64(0x04E4317F443B5BEB) /* 403 */, + CONST64(0x4B852D325939D0A6) /* 404 */, CONST64(0xD5AE6BEEFB207FFC) /* 405 */, + CONST64(0x309682B281C7D374) /* 406 */, CONST64(0xBAE309A194C3B475) /* 407 */, + CONST64(0x8CC3F97B13B49F05) /* 408 */, CONST64(0x98A9422FF8293967) /* 409 */, + CONST64(0x244B16B01076FF7C) /* 410 */, CONST64(0xF8BF571C663D67EE) /* 411 */, + CONST64(0x1F0D6758EEE30DA1) /* 412 */, CONST64(0xC9B611D97ADEB9B7) /* 413 */, + CONST64(0xB7AFD5887B6C57A2) /* 414 */, CONST64(0x6290AE846B984FE1) /* 415 */, + CONST64(0x94DF4CDEACC1A5FD) /* 416 */, CONST64(0x058A5BD1C5483AFF) /* 417 */, + CONST64(0x63166CC142BA3C37) /* 418 */, CONST64(0x8DB8526EB2F76F40) /* 419 */, + CONST64(0xE10880036F0D6D4E) /* 420 */, CONST64(0x9E0523C9971D311D) /* 421 */, + CONST64(0x45EC2824CC7CD691) /* 422 */, CONST64(0x575B8359E62382C9) /* 423 */, + CONST64(0xFA9E400DC4889995) /* 424 */, CONST64(0xD1823ECB45721568) /* 425 */, + CONST64(0xDAFD983B8206082F) /* 426 */, CONST64(0xAA7D29082386A8CB) /* 427 */, + CONST64(0x269FCD4403B87588) /* 428 */, CONST64(0x1B91F5F728BDD1E0) /* 429 */, + CONST64(0xE4669F39040201F6) /* 430 */, CONST64(0x7A1D7C218CF04ADE) /* 431 */, + CONST64(0x65623C29D79CE5CE) /* 432 */, CONST64(0x2368449096C00BB1) /* 433 */, + CONST64(0xAB9BF1879DA503BA) /* 434 */, CONST64(0xBC23ECB1A458058E) /* 435 */, + CONST64(0x9A58DF01BB401ECC) /* 436 */, CONST64(0xA070E868A85F143D) /* 437 */, + CONST64(0x4FF188307DF2239E) /* 438 */, CONST64(0x14D565B41A641183) /* 439 */, + CONST64(0xEE13337452701602) /* 440 */, CONST64(0x950E3DCF3F285E09) /* 441 */, + CONST64(0x59930254B9C80953) /* 442 */, CONST64(0x3BF299408930DA6D) /* 443 */, + CONST64(0xA955943F53691387) /* 444 */, CONST64(0xA15EDECAA9CB8784) /* 445 */, + CONST64(0x29142127352BE9A0) /* 446 */, CONST64(0x76F0371FFF4E7AFB) /* 447 */, + CONST64(0x0239F450274F2228) /* 448 */, CONST64(0xBB073AF01D5E868B) /* 449 */, + CONST64(0xBFC80571C10E96C1) /* 450 */, CONST64(0xD267088568222E23) /* 451 */, + CONST64(0x9671A3D48E80B5B0) /* 452 */, CONST64(0x55B5D38AE193BB81) /* 453 */, + CONST64(0x693AE2D0A18B04B8) /* 454 */, CONST64(0x5C48B4ECADD5335F) /* 455 */, + CONST64(0xFD743B194916A1CA) /* 456 */, CONST64(0x2577018134BE98C4) /* 457 */, + CONST64(0xE77987E83C54A4AD) /* 458 */, CONST64(0x28E11014DA33E1B9) /* 459 */, + CONST64(0x270CC59E226AA213) /* 460 */, CONST64(0x71495F756D1A5F60) /* 461 */, + CONST64(0x9BE853FB60AFEF77) /* 462 */, CONST64(0xADC786A7F7443DBF) /* 463 */, + CONST64(0x0904456173B29A82) /* 464 */, CONST64(0x58BC7A66C232BD5E) /* 465 */, + CONST64(0xF306558C673AC8B2) /* 466 */, CONST64(0x41F639C6B6C9772A) /* 467 */, + CONST64(0x216DEFE99FDA35DA) /* 468 */, CONST64(0x11640CC71C7BE615) /* 469 */, + CONST64(0x93C43694565C5527) /* 470 */, CONST64(0xEA038E6246777839) /* 471 */, + CONST64(0xF9ABF3CE5A3E2469) /* 472 */, CONST64(0x741E768D0FD312D2) /* 473 */, + CONST64(0x0144B883CED652C6) /* 474 */, CONST64(0xC20B5A5BA33F8552) /* 475 */, + CONST64(0x1AE69633C3435A9D) /* 476 */, CONST64(0x97A28CA4088CFDEC) /* 477 */, + CONST64(0x8824A43C1E96F420) /* 478 */, CONST64(0x37612FA66EEEA746) /* 479 */, + CONST64(0x6B4CB165F9CF0E5A) /* 480 */, CONST64(0x43AA1C06A0ABFB4A) /* 481 */, + CONST64(0x7F4DC26FF162796B) /* 482 */, CONST64(0x6CBACC8E54ED9B0F) /* 483 */, + CONST64(0xA6B7FFEFD2BB253E) /* 484 */, CONST64(0x2E25BC95B0A29D4F) /* 485 */, + CONST64(0x86D6A58BDEF1388C) /* 486 */, CONST64(0xDED74AC576B6F054) /* 487 */, + CONST64(0x8030BDBC2B45805D) /* 488 */, CONST64(0x3C81AF70E94D9289) /* 489 */, + CONST64(0x3EFF6DDA9E3100DB) /* 490 */, CONST64(0xB38DC39FDFCC8847) /* 491 */, + CONST64(0x123885528D17B87E) /* 492 */, CONST64(0xF2DA0ED240B1B642) /* 493 */, + CONST64(0x44CEFADCD54BF9A9) /* 494 */, CONST64(0x1312200E433C7EE6) /* 495 */, + CONST64(0x9FFCC84F3A78C748) /* 496 */, CONST64(0xF0CD1F72248576BB) /* 497 */, + CONST64(0xEC6974053638CFE4) /* 498 */, CONST64(0x2BA7B67C0CEC4E4C) /* 499 */, + CONST64(0xAC2F4DF3E5CE32ED) /* 500 */, CONST64(0xCB33D14326EA4C11) /* 501 */, + CONST64(0xA4E9044CC77E58BC) /* 502 */, CONST64(0x5F513293D934FCEF) /* 503 */, + CONST64(0x5DC9645506E55444) /* 504 */, CONST64(0x50DE418F317DE40A) /* 505 */, + CONST64(0x388CB31A69DDE259) /* 506 */, CONST64(0x2DB4A83455820A86) /* 507 */, + CONST64(0x9010A91E84711AE9) /* 508 */, CONST64(0x4DF7F0B7B1498371) /* 509 */, + CONST64(0xD62A2EABC0977179) /* 510 */, CONST64(0x22FAC097AA8D5C0E) /* 511 */, + CONST64(0xF49FCC2FF1DAF39B) /* 512 */, CONST64(0x487FD5C66FF29281) /* 513 */, + CONST64(0xE8A30667FCDCA83F) /* 514 */, CONST64(0x2C9B4BE3D2FCCE63) /* 515 */, + CONST64(0xDA3FF74B93FBBBC2) /* 516 */, CONST64(0x2FA165D2FE70BA66) /* 517 */, + CONST64(0xA103E279970E93D4) /* 518 */, CONST64(0xBECDEC77B0E45E71) /* 519 */, + CONST64(0xCFB41E723985E497) /* 520 */, CONST64(0xB70AAA025EF75017) /* 521 */, + CONST64(0xD42309F03840B8E0) /* 522 */, CONST64(0x8EFC1AD035898579) /* 523 */, + CONST64(0x96C6920BE2B2ABC5) /* 524 */, CONST64(0x66AF4163375A9172) /* 525 */, + CONST64(0x2174ABDCCA7127FB) /* 526 */, CONST64(0xB33CCEA64A72FF41) /* 527 */, + CONST64(0xF04A4933083066A5) /* 528 */, CONST64(0x8D970ACDD7289AF5) /* 529 */, + CONST64(0x8F96E8E031C8C25E) /* 530 */, CONST64(0xF3FEC02276875D47) /* 531 */, + CONST64(0xEC7BF310056190DD) /* 532 */, CONST64(0xF5ADB0AEBB0F1491) /* 533 */, + CONST64(0x9B50F8850FD58892) /* 534 */, CONST64(0x4975488358B74DE8) /* 535 */, + CONST64(0xA3354FF691531C61) /* 536 */, CONST64(0x0702BBE481D2C6EE) /* 537 */, + CONST64(0x89FB24057DEDED98) /* 538 */, CONST64(0xAC3075138596E902) /* 539 */, + CONST64(0x1D2D3580172772ED) /* 540 */, CONST64(0xEB738FC28E6BC30D) /* 541 */, + CONST64(0x5854EF8F63044326) /* 542 */, CONST64(0x9E5C52325ADD3BBE) /* 543 */, + CONST64(0x90AA53CF325C4623) /* 544 */, CONST64(0xC1D24D51349DD067) /* 545 */, + CONST64(0x2051CFEEA69EA624) /* 546 */, CONST64(0x13220F0A862E7E4F) /* 547 */, + CONST64(0xCE39399404E04864) /* 548 */, CONST64(0xD9C42CA47086FCB7) /* 549 */, + CONST64(0x685AD2238A03E7CC) /* 550 */, CONST64(0x066484B2AB2FF1DB) /* 551 */, + CONST64(0xFE9D5D70EFBF79EC) /* 552 */, CONST64(0x5B13B9DD9C481854) /* 553 */, + CONST64(0x15F0D475ED1509AD) /* 554 */, CONST64(0x0BEBCD060EC79851) /* 555 */, + CONST64(0xD58C6791183AB7F8) /* 556 */, CONST64(0xD1187C5052F3EEE4) /* 557 */, + CONST64(0xC95D1192E54E82FF) /* 558 */, CONST64(0x86EEA14CB9AC6CA2) /* 559 */, + CONST64(0x3485BEB153677D5D) /* 560 */, CONST64(0xDD191D781F8C492A) /* 561 */, + CONST64(0xF60866BAA784EBF9) /* 562 */, CONST64(0x518F643BA2D08C74) /* 563 */, + CONST64(0x8852E956E1087C22) /* 564 */, CONST64(0xA768CB8DC410AE8D) /* 565 */, + CONST64(0x38047726BFEC8E1A) /* 566 */, CONST64(0xA67738B4CD3B45AA) /* 567 */, + CONST64(0xAD16691CEC0DDE19) /* 568 */, CONST64(0xC6D4319380462E07) /* 569 */, + CONST64(0xC5A5876D0BA61938) /* 570 */, CONST64(0x16B9FA1FA58FD840) /* 571 */, + CONST64(0x188AB1173CA74F18) /* 572 */, CONST64(0xABDA2F98C99C021F) /* 573 */, + CONST64(0x3E0580AB134AE816) /* 574 */, CONST64(0x5F3B05B773645ABB) /* 575 */, + CONST64(0x2501A2BE5575F2F6) /* 576 */, CONST64(0x1B2F74004E7E8BA9) /* 577 */, + CONST64(0x1CD7580371E8D953) /* 578 */, CONST64(0x7F6ED89562764E30) /* 579 */, + CONST64(0xB15926FF596F003D) /* 580 */, CONST64(0x9F65293DA8C5D6B9) /* 581 */, + CONST64(0x6ECEF04DD690F84C) /* 582 */, CONST64(0x4782275FFF33AF88) /* 583 */, + CONST64(0xE41433083F820801) /* 584 */, CONST64(0xFD0DFE409A1AF9B5) /* 585 */, + CONST64(0x4325A3342CDB396B) /* 586 */, CONST64(0x8AE77E62B301B252) /* 587 */, + CONST64(0xC36F9E9F6655615A) /* 588 */, CONST64(0x85455A2D92D32C09) /* 589 */, + CONST64(0xF2C7DEA949477485) /* 590 */, CONST64(0x63CFB4C133A39EBA) /* 591 */, + CONST64(0x83B040CC6EBC5462) /* 592 */, CONST64(0x3B9454C8FDB326B0) /* 593 */, + CONST64(0x56F56A9E87FFD78C) /* 594 */, CONST64(0x2DC2940D99F42BC6) /* 595 */, + CONST64(0x98F7DF096B096E2D) /* 596 */, CONST64(0x19A6E01E3AD852BF) /* 597 */, + CONST64(0x42A99CCBDBD4B40B) /* 598 */, CONST64(0xA59998AF45E9C559) /* 599 */, + CONST64(0x366295E807D93186) /* 600 */, CONST64(0x6B48181BFAA1F773) /* 601 */, + CONST64(0x1FEC57E2157A0A1D) /* 602 */, CONST64(0x4667446AF6201AD5) /* 603 */, + CONST64(0xE615EBCACFB0F075) /* 604 */, CONST64(0xB8F31F4F68290778) /* 605 */, + CONST64(0x22713ED6CE22D11E) /* 606 */, CONST64(0x3057C1A72EC3C93B) /* 607 */, + CONST64(0xCB46ACC37C3F1F2F) /* 608 */, CONST64(0xDBB893FD02AAF50E) /* 609 */, + CONST64(0x331FD92E600B9FCF) /* 610 */, CONST64(0xA498F96148EA3AD6) /* 611 */, + CONST64(0xA8D8426E8B6A83EA) /* 612 */, CONST64(0xA089B274B7735CDC) /* 613 */, + CONST64(0x87F6B3731E524A11) /* 614 */, CONST64(0x118808E5CBC96749) /* 615 */, + CONST64(0x9906E4C7B19BD394) /* 616 */, CONST64(0xAFED7F7E9B24A20C) /* 617 */, + CONST64(0x6509EADEEB3644A7) /* 618 */, CONST64(0x6C1EF1D3E8EF0EDE) /* 619 */, + CONST64(0xB9C97D43E9798FB4) /* 620 */, CONST64(0xA2F2D784740C28A3) /* 621 */, + CONST64(0x7B8496476197566F) /* 622 */, CONST64(0x7A5BE3E6B65F069D) /* 623 */, + CONST64(0xF96330ED78BE6F10) /* 624 */, CONST64(0xEEE60DE77A076A15) /* 625 */, + CONST64(0x2B4BEE4AA08B9BD0) /* 626 */, CONST64(0x6A56A63EC7B8894E) /* 627 */, + CONST64(0x02121359BA34FEF4) /* 628 */, CONST64(0x4CBF99F8283703FC) /* 629 */, + CONST64(0x398071350CAF30C8) /* 630 */, CONST64(0xD0A77A89F017687A) /* 631 */, + CONST64(0xF1C1A9EB9E423569) /* 632 */, CONST64(0x8C7976282DEE8199) /* 633 */, + CONST64(0x5D1737A5DD1F7ABD) /* 634 */, CONST64(0x4F53433C09A9FA80) /* 635 */, + CONST64(0xFA8B0C53DF7CA1D9) /* 636 */, CONST64(0x3FD9DCBC886CCB77) /* 637 */, + CONST64(0xC040917CA91B4720) /* 638 */, CONST64(0x7DD00142F9D1DCDF) /* 639 */, + CONST64(0x8476FC1D4F387B58) /* 640 */, CONST64(0x23F8E7C5F3316503) /* 641 */, + CONST64(0x032A2244E7E37339) /* 642 */, CONST64(0x5C87A5D750F5A74B) /* 643 */, + CONST64(0x082B4CC43698992E) /* 644 */, CONST64(0xDF917BECB858F63C) /* 645 */, + CONST64(0x3270B8FC5BF86DDA) /* 646 */, CONST64(0x10AE72BB29B5DD76) /* 647 */, + CONST64(0x576AC94E7700362B) /* 648 */, CONST64(0x1AD112DAC61EFB8F) /* 649 */, + CONST64(0x691BC30EC5FAA427) /* 650 */, CONST64(0xFF246311CC327143) /* 651 */, + CONST64(0x3142368E30E53206) /* 652 */, CONST64(0x71380E31E02CA396) /* 653 */, + CONST64(0x958D5C960AAD76F1) /* 654 */, CONST64(0xF8D6F430C16DA536) /* 655 */, + CONST64(0xC8FFD13F1BE7E1D2) /* 656 */, CONST64(0x7578AE66004DDBE1) /* 657 */, + CONST64(0x05833F01067BE646) /* 658 */, CONST64(0xBB34B5AD3BFE586D) /* 659 */, + CONST64(0x095F34C9A12B97F0) /* 660 */, CONST64(0x247AB64525D60CA8) /* 661 */, + CONST64(0xDCDBC6F3017477D1) /* 662 */, CONST64(0x4A2E14D4DECAD24D) /* 663 */, + CONST64(0xBDB5E6D9BE0A1EEB) /* 664 */, CONST64(0x2A7E70F7794301AB) /* 665 */, + CONST64(0xDEF42D8A270540FD) /* 666 */, CONST64(0x01078EC0A34C22C1) /* 667 */, + CONST64(0xE5DE511AF4C16387) /* 668 */, CONST64(0x7EBB3A52BD9A330A) /* 669 */, + CONST64(0x77697857AA7D6435) /* 670 */, CONST64(0x004E831603AE4C32) /* 671 */, + CONST64(0xE7A21020AD78E312) /* 672 */, CONST64(0x9D41A70C6AB420F2) /* 673 */, + CONST64(0x28E06C18EA1141E6) /* 674 */, CONST64(0xD2B28CBD984F6B28) /* 675 */, + CONST64(0x26B75F6C446E9D83) /* 676 */, CONST64(0xBA47568C4D418D7F) /* 677 */, + CONST64(0xD80BADBFE6183D8E) /* 678 */, CONST64(0x0E206D7F5F166044) /* 679 */, + CONST64(0xE258A43911CBCA3E) /* 680 */, CONST64(0x723A1746B21DC0BC) /* 681 */, + CONST64(0xC7CAA854F5D7CDD3) /* 682 */, CONST64(0x7CAC32883D261D9C) /* 683 */, + CONST64(0x7690C26423BA942C) /* 684 */, CONST64(0x17E55524478042B8) /* 685 */, + CONST64(0xE0BE477656A2389F) /* 686 */, CONST64(0x4D289B5E67AB2DA0) /* 687 */, + CONST64(0x44862B9C8FBBFD31) /* 688 */, CONST64(0xB47CC8049D141365) /* 689 */, + CONST64(0x822C1B362B91C793) /* 690 */, CONST64(0x4EB14655FB13DFD8) /* 691 */, + CONST64(0x1ECBBA0714E2A97B) /* 692 */, CONST64(0x6143459D5CDE5F14) /* 693 */, + CONST64(0x53A8FBF1D5F0AC89) /* 694 */, CONST64(0x97EA04D81C5E5B00) /* 695 */, + CONST64(0x622181A8D4FDB3F3) /* 696 */, CONST64(0xE9BCD341572A1208) /* 697 */, + CONST64(0x1411258643CCE58A) /* 698 */, CONST64(0x9144C5FEA4C6E0A4) /* 699 */, + CONST64(0x0D33D06565CF620F) /* 700 */, CONST64(0x54A48D489F219CA1) /* 701 */, + CONST64(0xC43E5EAC6D63C821) /* 702 */, CONST64(0xA9728B3A72770DAF) /* 703 */, + CONST64(0xD7934E7B20DF87EF) /* 704 */, CONST64(0xE35503B61A3E86E5) /* 705 */, + CONST64(0xCAE321FBC819D504) /* 706 */, CONST64(0x129A50B3AC60BFA6) /* 707 */, + CONST64(0xCD5E68EA7E9FB6C3) /* 708 */, CONST64(0xB01C90199483B1C7) /* 709 */, + CONST64(0x3DE93CD5C295376C) /* 710 */, CONST64(0xAED52EDF2AB9AD13) /* 711 */, + CONST64(0x2E60F512C0A07884) /* 712 */, CONST64(0xBC3D86A3E36210C9) /* 713 */, + CONST64(0x35269D9B163951CE) /* 714 */, CONST64(0x0C7D6E2AD0CDB5FA) /* 715 */, + CONST64(0x59E86297D87F5733) /* 716 */, CONST64(0x298EF221898DB0E7) /* 717 */, + CONST64(0x55000029D1A5AA7E) /* 718 */, CONST64(0x8BC08AE1B5061B45) /* 719 */, + CONST64(0xC2C31C2B6C92703A) /* 720 */, CONST64(0x94CC596BAF25EF42) /* 721 */, + CONST64(0x0A1D73DB22540456) /* 722 */, CONST64(0x04B6A0F9D9C4179A) /* 723 */, + CONST64(0xEFFDAFA2AE3D3C60) /* 724 */, CONST64(0xF7C8075BB49496C4) /* 725 */, + CONST64(0x9CC5C7141D1CD4E3) /* 726 */, CONST64(0x78BD1638218E5534) /* 727 */, + CONST64(0xB2F11568F850246A) /* 728 */, CONST64(0xEDFABCFA9502BC29) /* 729 */, + CONST64(0x796CE5F2DA23051B) /* 730 */, CONST64(0xAAE128B0DC93537C) /* 731 */, + CONST64(0x3A493DA0EE4B29AE) /* 732 */, CONST64(0xB5DF6B2C416895D7) /* 733 */, + CONST64(0xFCABBD25122D7F37) /* 734 */, CONST64(0x70810B58105DC4B1) /* 735 */, + CONST64(0xE10FDD37F7882A90) /* 736 */, CONST64(0x524DCAB5518A3F5C) /* 737 */, + CONST64(0x3C9E85878451255B) /* 738 */, CONST64(0x4029828119BD34E2) /* 739 */, + CONST64(0x74A05B6F5D3CECCB) /* 740 */, CONST64(0xB610021542E13ECA) /* 741 */, + CONST64(0x0FF979D12F59E2AC) /* 742 */, CONST64(0x6037DA27E4F9CC50) /* 743 */, + CONST64(0x5E92975A0DF1847D) /* 744 */, CONST64(0xD66DE190D3E623FE) /* 745 */, + CONST64(0x5032D6B87B568048) /* 746 */, CONST64(0x9A36B7CE8235216E) /* 747 */, + CONST64(0x80272A7A24F64B4A) /* 748 */, CONST64(0x93EFED8B8C6916F7) /* 749 */, + CONST64(0x37DDBFF44CCE1555) /* 750 */, CONST64(0x4B95DB5D4B99BD25) /* 751 */, + CONST64(0x92D3FDA169812FC0) /* 752 */, CONST64(0xFB1A4A9A90660BB6) /* 753 */, + CONST64(0x730C196946A4B9B2) /* 754 */, CONST64(0x81E289AA7F49DA68) /* 755 */, + CONST64(0x64669A0F83B1A05F) /* 756 */, CONST64(0x27B3FF7D9644F48B) /* 757 */, + CONST64(0xCC6B615C8DB675B3) /* 758 */, CONST64(0x674F20B9BCEBBE95) /* 759 */, + CONST64(0x6F31238275655982) /* 760 */, CONST64(0x5AE488713E45CF05) /* 761 */, + CONST64(0xBF619F9954C21157) /* 762 */, CONST64(0xEABAC46040A8EAE9) /* 763 */, + CONST64(0x454C6FE9F2C0C1CD) /* 764 */, CONST64(0x419CF6496412691C) /* 765 */, + CONST64(0xD3DC3BEF265B0F70) /* 766 */, CONST64(0x6D0E60F5C3578A9E) /* 767 */, + CONST64(0x5B0E608526323C55) /* 768 */, CONST64(0x1A46C1A9FA1B59F5) /* 769 */, + CONST64(0xA9E245A17C4C8FFA) /* 770 */, CONST64(0x65CA5159DB2955D7) /* 771 */, + CONST64(0x05DB0A76CE35AFC2) /* 772 */, CONST64(0x81EAC77EA9113D45) /* 773 */, + CONST64(0x528EF88AB6AC0A0D) /* 774 */, CONST64(0xA09EA253597BE3FF) /* 775 */, + CONST64(0x430DDFB3AC48CD56) /* 776 */, CONST64(0xC4B3A67AF45CE46F) /* 777 */, + CONST64(0x4ECECFD8FBE2D05E) /* 778 */, CONST64(0x3EF56F10B39935F0) /* 779 */, + CONST64(0x0B22D6829CD619C6) /* 780 */, CONST64(0x17FD460A74DF2069) /* 781 */, + CONST64(0x6CF8CC8E8510ED40) /* 782 */, CONST64(0xD6C824BF3A6ECAA7) /* 783 */, + CONST64(0x61243D581A817049) /* 784 */, CONST64(0x048BACB6BBC163A2) /* 785 */, + CONST64(0xD9A38AC27D44CC32) /* 786 */, CONST64(0x7FDDFF5BAAF410AB) /* 787 */, + CONST64(0xAD6D495AA804824B) /* 788 */, CONST64(0xE1A6A74F2D8C9F94) /* 789 */, + CONST64(0xD4F7851235DEE8E3) /* 790 */, CONST64(0xFD4B7F886540D893) /* 791 */, + CONST64(0x247C20042AA4BFDA) /* 792 */, CONST64(0x096EA1C517D1327C) /* 793 */, + CONST64(0xD56966B4361A6685) /* 794 */, CONST64(0x277DA5C31221057D) /* 795 */, + CONST64(0x94D59893A43ACFF7) /* 796 */, CONST64(0x64F0C51CCDC02281) /* 797 */, + CONST64(0x3D33BCC4FF6189DB) /* 798 */, CONST64(0xE005CB184CE66AF1) /* 799 */, + CONST64(0xFF5CCD1D1DB99BEA) /* 800 */, CONST64(0xB0B854A7FE42980F) /* 801 */, + CONST64(0x7BD46A6A718D4B9F) /* 802 */, CONST64(0xD10FA8CC22A5FD8C) /* 803 */, + CONST64(0xD31484952BE4BD31) /* 804 */, CONST64(0xC7FA975FCB243847) /* 805 */, + CONST64(0x4886ED1E5846C407) /* 806 */, CONST64(0x28CDDB791EB70B04) /* 807 */, + CONST64(0xC2B00BE2F573417F) /* 808 */, CONST64(0x5C9590452180F877) /* 809 */, + CONST64(0x7A6BDDFFF370EB00) /* 810 */, CONST64(0xCE509E38D6D9D6A4) /* 811 */, + CONST64(0xEBEB0F00647FA702) /* 812 */, CONST64(0x1DCC06CF76606F06) /* 813 */, + CONST64(0xE4D9F28BA286FF0A) /* 814 */, CONST64(0xD85A305DC918C262) /* 815 */, + CONST64(0x475B1D8732225F54) /* 816 */, CONST64(0x2D4FB51668CCB5FE) /* 817 */, + CONST64(0xA679B9D9D72BBA20) /* 818 */, CONST64(0x53841C0D912D43A5) /* 819 */, + CONST64(0x3B7EAA48BF12A4E8) /* 820 */, CONST64(0x781E0E47F22F1DDF) /* 821 */, + CONST64(0xEFF20CE60AB50973) /* 822 */, CONST64(0x20D261D19DFFB742) /* 823 */, + CONST64(0x16A12B03062A2E39) /* 824 */, CONST64(0x1960EB2239650495) /* 825 */, + CONST64(0x251C16FED50EB8B8) /* 826 */, CONST64(0x9AC0C330F826016E) /* 827 */, + CONST64(0xED152665953E7671) /* 828 */, CONST64(0x02D63194A6369570) /* 829 */, + CONST64(0x5074F08394B1C987) /* 830 */, CONST64(0x70BA598C90B25CE1) /* 831 */, + CONST64(0x794A15810B9742F6) /* 832 */, CONST64(0x0D5925E9FCAF8C6C) /* 833 */, + CONST64(0x3067716CD868744E) /* 834 */, CONST64(0x910AB077E8D7731B) /* 835 */, + CONST64(0x6A61BBDB5AC42F61) /* 836 */, CONST64(0x93513EFBF0851567) /* 837 */, + CONST64(0xF494724B9E83E9D5) /* 838 */, CONST64(0xE887E1985C09648D) /* 839 */, + CONST64(0x34B1D3C675370CFD) /* 840 */, CONST64(0xDC35E433BC0D255D) /* 841 */, + CONST64(0xD0AAB84234131BE0) /* 842 */, CONST64(0x08042A50B48B7EAF) /* 843 */, + CONST64(0x9997C4EE44A3AB35) /* 844 */, CONST64(0x829A7B49201799D0) /* 845 */, + CONST64(0x263B8307B7C54441) /* 846 */, CONST64(0x752F95F4FD6A6CA6) /* 847 */, + CONST64(0x927217402C08C6E5) /* 848 */, CONST64(0x2A8AB754A795D9EE) /* 849 */, + CONST64(0xA442F7552F72943D) /* 850 */, CONST64(0x2C31334E19781208) /* 851 */, + CONST64(0x4FA98D7CEAEE6291) /* 852 */, CONST64(0x55C3862F665DB309) /* 853 */, + CONST64(0xBD0610175D53B1F3) /* 854 */, CONST64(0x46FE6CB840413F27) /* 855 */, + CONST64(0x3FE03792DF0CFA59) /* 856 */, CONST64(0xCFE700372EB85E8F) /* 857 */, + CONST64(0xA7BE29E7ADBCE118) /* 858 */, CONST64(0xE544EE5CDE8431DD) /* 859 */, + CONST64(0x8A781B1B41F1873E) /* 860 */, CONST64(0xA5C94C78A0D2F0E7) /* 861 */, + CONST64(0x39412E2877B60728) /* 862 */, CONST64(0xA1265EF3AFC9A62C) /* 863 */, + CONST64(0xBCC2770C6A2506C5) /* 864 */, CONST64(0x3AB66DD5DCE1CE12) /* 865 */, + CONST64(0xE65499D04A675B37) /* 866 */, CONST64(0x7D8F523481BFD216) /* 867 */, + CONST64(0x0F6F64FCEC15F389) /* 868 */, CONST64(0x74EFBE618B5B13C8) /* 869 */, + CONST64(0xACDC82B714273E1D) /* 870 */, CONST64(0xDD40BFE003199D17) /* 871 */, + CONST64(0x37E99257E7E061F8) /* 872 */, CONST64(0xFA52626904775AAA) /* 873 */, + CONST64(0x8BBBF63A463D56F9) /* 874 */, CONST64(0xF0013F1543A26E64) /* 875 */, + CONST64(0xA8307E9F879EC898) /* 876 */, CONST64(0xCC4C27A4150177CC) /* 877 */, + CONST64(0x1B432F2CCA1D3348) /* 878 */, CONST64(0xDE1D1F8F9F6FA013) /* 879 */, + CONST64(0x606602A047A7DDD6) /* 880 */, CONST64(0xD237AB64CC1CB2C7) /* 881 */, + CONST64(0x9B938E7225FCD1D3) /* 882 */, CONST64(0xEC4E03708E0FF476) /* 883 */, + CONST64(0xFEB2FBDA3D03C12D) /* 884 */, CONST64(0xAE0BCED2EE43889A) /* 885 */, + CONST64(0x22CB8923EBFB4F43) /* 886 */, CONST64(0x69360D013CF7396D) /* 887 */, + CONST64(0x855E3602D2D4E022) /* 888 */, CONST64(0x073805BAD01F784C) /* 889 */, + CONST64(0x33E17A133852F546) /* 890 */, CONST64(0xDF4874058AC7B638) /* 891 */, + CONST64(0xBA92B29C678AA14A) /* 892 */, CONST64(0x0CE89FC76CFAADCD) /* 893 */, + CONST64(0x5F9D4E0908339E34) /* 894 */, CONST64(0xF1AFE9291F5923B9) /* 895 */, + CONST64(0x6E3480F60F4A265F) /* 896 */, CONST64(0xEEBF3A2AB29B841C) /* 897 */, + CONST64(0xE21938A88F91B4AD) /* 898 */, CONST64(0x57DFEFF845C6D3C3) /* 899 */, + CONST64(0x2F006B0BF62CAAF2) /* 900 */, CONST64(0x62F479EF6F75EE78) /* 901 */, + CONST64(0x11A55AD41C8916A9) /* 902 */, CONST64(0xF229D29084FED453) /* 903 */, + CONST64(0x42F1C27B16B000E6) /* 904 */, CONST64(0x2B1F76749823C074) /* 905 */, + CONST64(0x4B76ECA3C2745360) /* 906 */, CONST64(0x8C98F463B91691BD) /* 907 */, + CONST64(0x14BCC93CF1ADE66A) /* 908 */, CONST64(0x8885213E6D458397) /* 909 */, + CONST64(0x8E177DF0274D4711) /* 910 */, CONST64(0xB49B73B5503F2951) /* 911 */, + CONST64(0x10168168C3F96B6B) /* 912 */, CONST64(0x0E3D963B63CAB0AE) /* 913 */, + CONST64(0x8DFC4B5655A1DB14) /* 914 */, CONST64(0xF789F1356E14DE5C) /* 915 */, + CONST64(0x683E68AF4E51DAC1) /* 916 */, CONST64(0xC9A84F9D8D4B0FD9) /* 917 */, + CONST64(0x3691E03F52A0F9D1) /* 918 */, CONST64(0x5ED86E46E1878E80) /* 919 */, + CONST64(0x3C711A0E99D07150) /* 920 */, CONST64(0x5A0865B20C4E9310) /* 921 */, + CONST64(0x56FBFC1FE4F0682E) /* 922 */, CONST64(0xEA8D5DE3105EDF9B) /* 923 */, + CONST64(0x71ABFDB12379187A) /* 924 */, CONST64(0x2EB99DE1BEE77B9C) /* 925 */, + CONST64(0x21ECC0EA33CF4523) /* 926 */, CONST64(0x59A4D7521805C7A1) /* 927 */, + CONST64(0x3896F5EB56AE7C72) /* 928 */, CONST64(0xAA638F3DB18F75DC) /* 929 */, + CONST64(0x9F39358DABE9808E) /* 930 */, CONST64(0xB7DEFA91C00B72AC) /* 931 */, + CONST64(0x6B5541FD62492D92) /* 932 */, CONST64(0x6DC6DEE8F92E4D5B) /* 933 */, + CONST64(0x353F57ABC4BEEA7E) /* 934 */, CONST64(0x735769D6DA5690CE) /* 935 */, + CONST64(0x0A234AA642391484) /* 936 */, CONST64(0xF6F9508028F80D9D) /* 937 */, + CONST64(0xB8E319A27AB3F215) /* 938 */, CONST64(0x31AD9C1151341A4D) /* 939 */, + CONST64(0x773C22A57BEF5805) /* 940 */, CONST64(0x45C7561A07968633) /* 941 */, + CONST64(0xF913DA9E249DBE36) /* 942 */, CONST64(0xDA652D9B78A64C68) /* 943 */, + CONST64(0x4C27A97F3BC334EF) /* 944 */, CONST64(0x76621220E66B17F4) /* 945 */, + CONST64(0x967743899ACD7D0B) /* 946 */, CONST64(0xF3EE5BCAE0ED6782) /* 947 */, + CONST64(0x409F753600C879FC) /* 948 */, CONST64(0x06D09A39B5926DB6) /* 949 */, + CONST64(0x6F83AEB0317AC588) /* 950 */, CONST64(0x01E6CA4A86381F21) /* 951 */, + CONST64(0x66FF3462D19F3025) /* 952 */, CONST64(0x72207C24DDFD3BFB) /* 953 */, + CONST64(0x4AF6B6D3E2ECE2EB) /* 954 */, CONST64(0x9C994DBEC7EA08DE) /* 955 */, + CONST64(0x49ACE597B09A8BC4) /* 956 */, CONST64(0xB38C4766CF0797BA) /* 957 */, + CONST64(0x131B9373C57C2A75) /* 958 */, CONST64(0xB1822CCE61931E58) /* 959 */, + CONST64(0x9D7555B909BA1C0C) /* 960 */, CONST64(0x127FAFDD937D11D2) /* 961 */, + CONST64(0x29DA3BADC66D92E4) /* 962 */, CONST64(0xA2C1D57154C2ECBC) /* 963 */, + CONST64(0x58C5134D82F6FE24) /* 964 */, CONST64(0x1C3AE3515B62274F) /* 965 */, + CONST64(0xE907C82E01CB8126) /* 966 */, CONST64(0xF8ED091913E37FCB) /* 967 */, + CONST64(0x3249D8F9C80046C9) /* 968 */, CONST64(0x80CF9BEDE388FB63) /* 969 */, + CONST64(0x1881539A116CF19E) /* 970 */, CONST64(0x5103F3F76BD52457) /* 971 */, + CONST64(0x15B7E6F5AE47F7A8) /* 972 */, CONST64(0xDBD7C6DED47E9CCF) /* 973 */, + CONST64(0x44E55C410228BB1A) /* 974 */, CONST64(0xB647D4255EDB4E99) /* 975 */, + CONST64(0x5D11882BB8AAFC30) /* 976 */, CONST64(0xF5098BBB29D3212A) /* 977 */, + CONST64(0x8FB5EA14E90296B3) /* 978 */, CONST64(0x677B942157DD025A) /* 979 */, + CONST64(0xFB58E7C0A390ACB5) /* 980 */, CONST64(0x89D3674C83BD4A01) /* 981 */, + CONST64(0x9E2DA4DF4BF3B93B) /* 982 */, CONST64(0xFCC41E328CAB4829) /* 983 */, + CONST64(0x03F38C96BA582C52) /* 984 */, CONST64(0xCAD1BDBD7FD85DB2) /* 985 */, + CONST64(0xBBB442C16082AE83) /* 986 */, CONST64(0xB95FE86BA5DA9AB0) /* 987 */, + CONST64(0xB22E04673771A93F) /* 988 */, CONST64(0x845358C9493152D8) /* 989 */, + CONST64(0xBE2A488697B4541E) /* 990 */, CONST64(0x95A2DC2DD38E6966) /* 991 */, + CONST64(0xC02C11AC923C852B) /* 992 */, CONST64(0x2388B1990DF2A87B) /* 993 */, + CONST64(0x7C8008FA1B4F37BE) /* 994 */, CONST64(0x1F70D0C84D54E503) /* 995 */, + CONST64(0x5490ADEC7ECE57D4) /* 996 */, CONST64(0x002B3C27D9063A3A) /* 997 */, + CONST64(0x7EAEA3848030A2BF) /* 998 */, CONST64(0xC602326DED2003C0) /* 999 */, + CONST64(0x83A7287D69A94086) /* 1000 */, CONST64(0xC57A5FCB30F57A8A) /* 1001 */, + CONST64(0xB56844E479EBE779) /* 1002 */, CONST64(0xA373B40F05DCBCE9) /* 1003 */, + CONST64(0xD71A786E88570EE2) /* 1004 */, CONST64(0x879CBACDBDE8F6A0) /* 1005 */, + CONST64(0x976AD1BCC164A32F) /* 1006 */, CONST64(0xAB21E25E9666D78B) /* 1007 */, + CONST64(0x901063AAE5E5C33C) /* 1008 */, CONST64(0x9818B34448698D90) /* 1009 */, + CONST64(0xE36487AE3E1E8ABB) /* 1010 */, CONST64(0xAFBDF931893BDCB4) /* 1011 */, + CONST64(0x6345A0DC5FBBD519) /* 1012 */, CONST64(0x8628FE269B9465CA) /* 1013 */, + CONST64(0x1E5D01603F9C51EC) /* 1014 */, CONST64(0x4DE44006A15049B7) /* 1015 */, + CONST64(0xBF6C70E5F776CBB1) /* 1016 */, CONST64(0x411218F2EF552BED) /* 1017 */, + CONST64(0xCB0C0708705A36A3) /* 1018 */, CONST64(0xE74D14754F986044) /* 1019 */, + CONST64(0xCD56D9430EA8280E) /* 1020 */, CONST64(0xC12591D7535F5065) /* 1021 */, + CONST64(0xC83223F1720AEF96) /* 1022 */, CONST64(0xC3A0396F7363A51F) /* 1023 */}; + +#ifdef _MSC_VER + #define INLINE __inline +#else + #define INLINE +#endif + +/* one round of the hash function */ +INLINE static void round(ulong64 *a, ulong64 *b, ulong64 *c, ulong64 x, int mul) +{ + ulong64 tmp; + tmp = (*c ^= x); + *a -= t1[byte(tmp, 0)] ^ t2[byte(tmp, 2)] ^ t3[byte(tmp, 4)] ^ t4[byte(tmp, 6)]; + tmp = (*b += t4[byte(tmp, 1)] ^ t3[byte(tmp, 3)] ^ t2[byte(tmp,5)] ^ t1[byte(tmp,7)]); + switch (mul) { + case 5: *b = (tmp << 2) + tmp; break; + case 7: *b = (tmp << 3) - tmp; break; + case 9: *b = (tmp << 3) + tmp; break; + } +} + +/* one complete pass */ +static void pass(ulong64 *a, ulong64 *b, ulong64 *c, ulong64 *x, int mul) +{ + round(a,b,c,x[0],mul); + round(b,c,a,x[1],mul); + round(c,a,b,x[2],mul); + round(a,b,c,x[3],mul); + round(b,c,a,x[4],mul); + round(c,a,b,x[5],mul); + round(a,b,c,x[6],mul); + round(b,c,a,x[7],mul); +} + +/* The key mixing schedule */ +static void key_schedule(ulong64 *x) +{ + x[0] -= x[7] ^ CONST64(0xA5A5A5A5A5A5A5A5); + x[1] ^= x[0]; + x[2] += x[1]; + x[3] -= x[2] ^ ((~x[1])<<19); + x[4] ^= x[3]; + x[5] += x[4]; + x[6] -= x[5] ^ ((~x[4])>>23); + x[7] ^= x[6]; + x[0] += x[7]; + x[1] -= x[0] ^ ((~x[7])<<19); + x[2] ^= x[1]; + x[3] += x[2]; + x[4] -= x[3] ^ ((~x[2])>>23); + x[5] ^= x[4]; + x[6] += x[5]; + x[7] -= x[6] ^ CONST64(0x0123456789ABCDEF); +} + +#ifdef CLEAN_STACK +static void _tiger_compress(hash_state *md, unsigned char *buf) +#else +static void tiger_compress(hash_state *md, unsigned char *buf) +#endif +{ + ulong64 a, b, c, x[8]; + unsigned long i; + + /* load words */ + for (i = 0; i < 8; i++) { + LOAD64L(x[i],&buf[8*i]); + } + a = md->tiger.state[0]; + b = md->tiger.state[1]; + c = md->tiger.state[2]; + + pass(&a,&b,&c,x,5); + key_schedule(x); + pass(&c,&a,&b,x,7); + key_schedule(x); + pass(&b,&c,&a,x,9); + + /* store state */ + md->tiger.state[0] = a ^ md->tiger.state[0]; + md->tiger.state[1] = b - md->tiger.state[1]; + md->tiger.state[2] = c + md->tiger.state[2]; +} + +#ifdef CLEAN_STACK +static void tiger_compress(hash_state *md, unsigned char *buf) +{ + _tiger_compress(md, buf); + burn_stack(sizeof(ulong64) * 11 + sizeof(unsigned long)); +} +#endif + +void tiger_init(hash_state *md) +{ + _ARGCHK(md != NULL); + md->tiger.state[0] = CONST64(0x0123456789ABCDEF); + md->tiger.state[1] = CONST64(0xFEDCBA9876543210); + md->tiger.state[2] = CONST64(0xF096A5B4C3B2E187); + md->tiger.curlen = 0; + md->tiger.length = 0; +} + +HASH_PROCESS(tiger_process, tiger_compress, tiger, 64) + +int tiger_done(hash_state * md, unsigned char *hash) +{ + _ARGCHK(md != NULL); + _ARGCHK(hash != NULL); + + if (md->tiger.curlen >= sizeof(md->tiger.buf)) { + return CRYPT_INVALID_ARG; + } + + /* increase the length of the message */ + md->tiger.length += md->tiger.curlen * 8; + + /* append the '1' bit */ + md->tiger.buf[md->tiger.curlen++] = (unsigned char)0x01; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. */ + if (md->tiger.curlen > 56) { + while (md->tiger.curlen < 64) { + md->tiger.buf[md->tiger.curlen++] = (unsigned char)0; + } + tiger_compress(md, md->tiger.buf); + md->tiger.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->tiger.curlen < 56) { + md->tiger.buf[md->tiger.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64L(md->tiger.length, md->tiger.buf+56); + tiger_compress(md, md->tiger.buf); + + /* copy output */ + STORE64L(md->tiger.state[0], &hash[0]); + STORE64L(md->tiger.state[1], &hash[8]); + STORE64L(md->tiger.state[2], &hash[16]); +#ifdef CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + + return CRYPT_OK; +} + +int tiger_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char hash[24]; + } tests[] = { + { "", + { 0x32, 0x93, 0xac, 0x63, 0x0c, 0x13, 0xf0, 0x24, + 0x5f, 0x92, 0xbb, 0xb1, 0x76, 0x6e, 0x16, 0x16, + 0x7a, 0x4e, 0x58, 0x49, 0x2d, 0xde, 0x73, 0xf3 } + }, + { "abc", + { 0x2a, 0xab, 0x14, 0x84, 0xe8, 0xc1, 0x58, 0xf2, + 0xbf, 0xb8, 0xc5, 0xff, 0x41, 0xb5, 0x7a, 0x52, + 0x51, 0x29, 0x13, 0x1c, 0x95, 0x7b, 0x5f, 0x93 } + }, + { "Tiger", + { 0xdd, 0x00, 0x23, 0x07, 0x99, 0xf5, 0x00, 0x9f, + 0xec, 0x6d, 0xeb, 0xc8, 0x38, 0xbb, 0x6a, 0x27, + 0xdf, 0x2b, 0x9d, 0x6f, 0x11, 0x0c, 0x79, 0x37 } + }, + { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-", + { 0xf7, 0x1c, 0x85, 0x83, 0x90, 0x2a, 0xfb, 0x87, + 0x9e, 0xdf, 0xe6, 0x10, 0xf8, 0x2c, 0x0d, 0x47, + 0x86, 0xa3, 0xa5, 0x34, 0x50, 0x44, 0x86, 0xb5 } + }, + { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-", + { 0xc5, 0x40, 0x34, 0xe5, 0xb4, 0x3e, 0xb8, 0x00, + 0x58, 0x48, 0xa7, 0xe0, 0xae, 0x6a, 0xac, 0x76, + 0xe4, 0xff, 0x59, 0x0a, 0xe7, 0x15, 0xfd, 0x25 } + }, + }; + + int i; + unsigned char tmp[24]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + tiger_init(&md); + tiger_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + tiger_done(&md, tmp); + if (memcmp(tmp, tests[i].hash, 24) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#endif + +/* +Hash of "": + 24F0130C63AC9332 16166E76B1BB925F F373DE2D49584E7A +Hash of "abc": + F258C1E88414AB2A 527AB541FFC5B8BF 935F7B951C132951 +Hash of "Tiger": + 9F00F599072300DD 276ABB38C8EB6DEC 37790C116F9D2BDF +Hash of "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-": + 87FB2A9083851CF7 470D2CF810E6DF9E B586445034A5A386 +Hash of "ABCDEFGHIJKLMNOPQRSTUVWXYZ=abcdefghijklmnopqrstuvwxyz+0123456789": + 467DB80863EBCE48 8DF1CD1261655DE9 57896565975F9197 +Hash of "Tiger - A Fast New Hash Function, by Ross Anderson and Eli Biham": + 0C410A042968868A 1671DA5A3FD29A72 5EC1E457D3CDB303 +Hash of "Tiger - A Fast New Hash Function, by Ross Anderson and Eli Biham, proceedings of Fast Software Encryption 3, Cambridge.": + EBF591D5AFA655CE 7F22894FF87F54AC 89C811B6B0DA3193 +Hash of "Tiger - A Fast New Hash Function, by Ross Anderson and Eli Biham, proceedings of Fast Software Encryption 3, Cambridge, 1996.": + 3D9AEB03D1BD1A63 57B2774DFD6D5B24 DD68151D503974FC +Hash of "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-": + 00B83EB4E53440C5 76AC6AAEE0A74858 25FD15E70A59FFE4 +*/ + + + diff -r 712dd6dfb0eb -r b939f2d4431e whirl.c --- a/whirl.c Tue Jun 15 14:34:07 2004 +0000 +++ b/whirl.c Tue Jun 15 16:47:55 2004 +0000 @@ -0,0 +1,280 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@iahu.ca, http://libtomcrypt.org + */ + +/* WHIRLPOOL (using their new sbox) hash function by Tom St Denis */ + +#include "mycrypt.h" + +#ifdef WHIRLPOOL + +const struct _hash_descriptor whirlpool_desc = +{ + "whirlpool", + 11, + 64, + 64, + + /* DER encoding (not yet supported) */ + { 0x00 }, + 0, + + &whirlpool_init, + &whirlpool_process, + &whirlpool_done, + &whirlpool_test +}; + +/* the sboxes */ +#include "whirltab.c" + +/* get a_{i,j} */ +#define GB(a,i,j) ((a[(i) & 7] >> (8 * (j))) & 255) + +/* shortcut macro to perform three functions at once */ +#define theta_pi_gamma(a, i) \ + SB0(GB(a, i-0, 7)) ^ \ + SB1(GB(a, i-1, 6)) ^ \ + SB2(GB(a, i-2, 5)) ^ \ + SB3(GB(a, i-3, 4)) ^ \ + SB4(GB(a, i-4, 3)) ^ \ + SB5(GB(a, i-5, 2)) ^ \ + SB6(GB(a, i-6, 1)) ^ \ + SB7(GB(a, i-7, 0)) + +#ifdef CLEAN_STACK +static void _whirlpool_compress(hash_state *md, unsigned char *buf) +#else +static void whirlpool_compress(hash_state *md, unsigned char *buf) +#endif +{ + ulong64 K[2][8], T[3][8]; + int x, y; + + /* load the block/state */ + for (x = 0; x < 8; x++) { + K[0][x] = md->whirlpool.state[x]; + + LOAD64H(T[0][x], buf + (8 * x)); + T[2][x] = T[0][x]; + T[0][x] ^= K[0][x]; + } + + /* do rounds 1..10 */ + for (x = 0; x < 10; x += 2) { + /* odd round */ + /* apply main transform to K[0] into K[1] */ + for (y = 0; y < 8; y++) { + K[1][y] = theta_pi_gamma(K[0], y); + } + /* xor the constant */ + K[1][0] ^= cont[x]; + + /* apply main transform to T[0] into T[1] */ + for (y = 0; y < 8; y++) { + T[1][y] = theta_pi_gamma(T[0], y) ^ K[1][y]; + } + + /* even round */ + /* apply main transform to K[1] into K[0] */ + for (y = 0; y < 8; y++) { + K[0][y] = theta_pi_gamma(K[1], y); + } + /* xor the constant */ + K[0][0] ^= cont[x+1]; + + /* apply main transform to T[0] into T[1] */ + for (y = 0; y < 8; y++) { + T[0][y] = theta_pi_gamma(T[1], y) ^ K[0][y]; + } + } + + /* store state */ + for (x = 0; x < 8; x++) { + md->whirlpool.state[x] ^= T[0][x] ^ T[2][x]; + } +} + + +#ifdef CLEAN_STACK +static void whirlpool_compress(hash_state *md, unsigned char *buf) +{ + _whirlpool_compress(md, buf); + burn_stack((5 * 8 * sizeof(ulong64)) + (2 * sizeof(int))); +} +#endif + + +void whirlpool_init(hash_state * md) +{ + _ARGCHK(md != NULL); + zeromem(&md->whirlpool, sizeof(md->whirlpool)); +} + +HASH_PROCESS(whirlpool_process, whirlpool_compress, whirlpool, 64) + +int whirlpool_done(hash_state * md, unsigned char *hash) +{ + int i; + + _ARGCHK(md != NULL); + _ARGCHK(hash != NULL); + + if (md->whirlpool.curlen >= sizeof(md->whirlpool.buf)) { + return CRYPT_INVALID_ARG; + } + + /* increase the length of the message */ + md->whirlpool.length += md->whirlpool.curlen * 8; + + /* append the '1' bit */ + md->whirlpool.buf[md->whirlpool.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 32 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->whirlpool.curlen > 32) { + while (md->whirlpool.curlen < 64) { + md->whirlpool.buf[md->whirlpool.curlen++] = (unsigned char)0; + } + whirlpool_compress(md, md->whirlpool.buf); + md->whirlpool.curlen = 0; + } + + /* pad upto 56 bytes of zeroes (should be 32 but we only support 64-bit lengths) */ + while (md->whirlpool.curlen < 56) { + md->whirlpool.buf[md->whirlpool.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64H(md->whirlpool.length, md->whirlpool.buf+56); + whirlpool_compress(md, md->whirlpool.buf); + + /* copy output */ + for (i = 0; i < 8; i++) { + STORE64H(md->whirlpool.state[i], hash+(8*i)); + } +#ifdef CLEAN_STACK + zeromem(md, sizeof(*md)); +#endif + return CRYPT_OK; +} + + +int whirlpool_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + int len; + unsigned char msg[128], hash[64]; + } tests[] = { + + /* NULL Message */ +{ + 0, + { 0x00 }, + { 0x19, 0xFA, 0x61, 0xD7, 0x55, 0x22, 0xA4, 0x66, 0x9B, 0x44, 0xE3, 0x9C, 0x1D, 0x2E, 0x17, 0x26, + 0xC5, 0x30, 0x23, 0x21, 0x30, 0xD4, 0x07, 0xF8, 0x9A, 0xFE, 0xE0, 0x96, 0x49, 0x97, 0xF7, 0xA7, + 0x3E, 0x83, 0xBE, 0x69, 0x8B, 0x28, 0x8F, 0xEB, 0xCF, 0x88, 0xE3, 0xE0, 0x3C, 0x4F, 0x07, 0x57, + 0xEA, 0x89, 0x64, 0xE5, 0x9B, 0x63, 0xD9, 0x37, 0x08, 0xB1, 0x38, 0xCC, 0x42, 0xA6, 0x6E, 0xB3 } +}, + + + /* 448-bits of 0 bits */ +{ + + 56, + { 0x00 }, + { 0x0B, 0x3F, 0x53, 0x78, 0xEB, 0xED, 0x2B, 0xF4, 0xD7, 0xBE, 0x3C, 0xFD, 0x81, 0x8C, 0x1B, 0x03, + 0xB6, 0xBB, 0x03, 0xD3, 0x46, 0x94, 0x8B, 0x04, 0xF4, 0xF4, 0x0C, 0x72, 0x6F, 0x07, 0x58, 0x70, + 0x2A, 0x0F, 0x1E, 0x22, 0x58, 0x80, 0xE3, 0x8D, 0xD5, 0xF6, 0xED, 0x6D, 0xE9, 0xB1, 0xE9, 0x61, + 0xE4, 0x9F, 0xC1, 0x31, 0x8D, 0x7C, 0xB7, 0x48, 0x22, 0xF3, 0xD0, 0xE2, 0xE9, 0xA7, 0xE7, 0xB0 } +}, + + /* 520-bits of 0 bits */ +{ + 65, + { 0x00 }, + { 0x85, 0xE1, 0x24, 0xC4, 0x41, 0x5B, 0xCF, 0x43, 0x19, 0x54, 0x3E, 0x3A, 0x63, 0xFF, 0x57, 0x1D, + 0x09, 0x35, 0x4C, 0xEE, 0xBE, 0xE1, 0xE3, 0x25, 0x30, 0x8C, 0x90, 0x69, 0xF4, 0x3E, 0x2A, 0xE4, + 0xD0, 0xE5, 0x1D, 0x4E, 0xB1, 0xE8, 0x64, 0x28, 0x70, 0x19, 0x4E, 0x95, 0x30, 0xD8, 0xD8, 0xAF, + 0x65, 0x89, 0xD1, 0xBF, 0x69, 0x49, 0xDD, 0xF9, 0x0A, 0x7F, 0x12, 0x08, 0x62, 0x37, 0x95, 0xB9 } +}, + + /* 512-bits, leading set */ +{ + 64, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x10, 0x3E, 0x00, 0x55, 0xA9, 0xB0, 0x90, 0xE1, 0x1C, 0x8F, 0xDD, 0xEB, 0xBA, 0x06, 0xC0, 0x5A, + 0xCE, 0x8B, 0x64, 0xB8, 0x96, 0x12, 0x8F, 0x6E, 0xED, 0x30, 0x71, 0xFC, 0xF3, 0xDC, 0x16, 0x94, + 0x67, 0x78, 0xE0, 0x72, 0x23, 0x23, 0x3F, 0xD1, 0x80, 0xFC, 0x40, 0xCC, 0xDB, 0x84, 0x30, 0xA6, + 0x40, 0xE3, 0x76, 0x34, 0x27, 0x1E, 0x65, 0x5C, 0xA1, 0x67, 0x4E, 0xBF, 0xF5, 0x07, 0xF8, 0xCB } +}, + + /* 512-bits, leading set of second byte */ +{ + 64, + { 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x35, 0x7B, 0x42, 0xEA, 0x79, 0xBC, 0x97, 0x86, 0x97, 0x5A, 0x3C, 0x44, 0x70, 0xAA, 0xB2, 0x3E, + 0x62, 0x29, 0x79, 0x7B, 0xAD, 0xBD, 0x54, 0x36, 0x5B, 0x54, 0x96, 0xE5, 0x5D, 0x9D, 0xD7, 0x9F, + 0xE9, 0x62, 0x4F, 0xB4, 0x22, 0x66, 0x93, 0x0A, 0x62, 0x8E, 0xD4, 0xDB, 0x08, 0xF9, 0xDD, 0x35, + 0xEF, 0x1B, 0xE1, 0x04, 0x53, 0xFC, 0x18, 0xF4, 0x2C, 0x7F, 0x5E, 0x1F, 0x9B, 0xAE, 0x55, 0xE0 } +}, + + /* 512-bits, leading set of last byte */ +{ + 64, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80 }, + { 0x8B, 0x39, 0x04, 0xDD, 0x19, 0x81, 0x41, 0x26, 0xFD, 0x02, 0x74, 0xAB, 0x49, 0xC5, 0x97, 0xF6, + 0xD7, 0x75, 0x33, 0x52, 0xA2, 0xDD, 0x91, 0xFD, 0x8F, 0x9F, 0x54, 0x05, 0x4C, 0x54, 0xBF, 0x0F, + 0x06, 0xDB, 0x4F, 0xF7, 0x08, 0xA3, 0xA2, 0x8B, 0xC3, 0x7A, 0x92, 0x1E, 0xEE, 0x11, 0xED, 0x7B, + 0x6A, 0x53, 0x79, 0x32, 0xCC, 0x5E, 0x94, 0xEE, 0x1E, 0xA6, 0x57, 0x60, 0x7E, 0x36, 0xC9, 0xF7 } +}, + +}; + + int i; + unsigned char tmp[64]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { + whirlpool_init(&md); + whirlpool_process(&md, (unsigned char *)tests[i].msg, tests[i].len); + whirlpool_done(&md, tmp); + if (memcmp(tmp, tests[i].hash, 64) != 0) { +#if 0 + printf("\nFailed test %d\n", i); + for (i = 0; i < 64; ) { + printf("%02x ", tmp[i]); + if (!(++i & 15)) printf("\n"); + } +#endif + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + + +#endif + diff -r 712dd6dfb0eb -r b939f2d4431e yarrow.c --- a/yarrow.c Tue Jun 15 14:34:07 2004 +0000 +++ b/yarrow.c Tue Jun 15 16:47:55 2004 +0000 @@ -0,0 +1,184 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@iahu.ca, http://libtomcrypt.org + */ + +#include "mycrypt.h" + +#ifdef YARROW + +const struct _prng_descriptor yarrow_desc = +{ + "yarrow", + &yarrow_start, + &yarrow_add_entropy, + &yarrow_ready, + &yarrow_read +}; + +int yarrow_start(prng_state *prng) +{ + int err; + + _ARGCHK(prng != NULL); + + /* these are the default hash/cipher combo used */ +#ifdef RIJNDAEL +#if YARROW_AES==0 + prng->yarrow.cipher = register_cipher(&rijndael_enc_desc); +#elif YARROW_AES==1 + prng->yarrow.cipher = register_cipher(&aes_enc_desc); +#elif YARROW_AES==2 + prng->yarrow.cipher = register_cipher(&rijndael_desc); +#elif YARROW_AES==3 + prng->yarrow.cipher = register_cipher(&aes_desc); +#endif +#elif defined(BLOWFISH) + prng->yarrow.cipher = register_cipher(&blowfish_desc); +#elif defined(TWOFISH) + prng->yarrow.cipher = register_cipher(&twofish_desc); +#elif defined(RC6) + prng->yarrow.cipher = register_cipher(&rc6_desc); +#elif defined(RC5) + prng->yarrow.cipher = register_cipher(&rc5_desc); +#elif defined(SAFERP) + prng->yarrow.cipher = register_cipher(&saferp_desc); +#elif defined(RC2) + prng->yarrow.cipher = register_cipher(&rc2_desc); +#elif defined(NOEKEON) + prng->yarrow.cipher = register_cipher(&noekeon_desc); +#elif defined(CAST5) + prng->yarrow.cipher = register_cipher(&cast5_desc); +#elif defined(XTEA) + prng->yarrow.cipher = register_cipher(&xtea_desc); +#elif defined(SAFER) + prng->yarrow.cipher = register_cipher(&safer_sk128_desc); +#elif defined(DES) + prng->yarrow.cipher = register_cipher(&des3_desc); +#elif + #error YARROW needs at least one CIPHER +#endif + if ((err = cipher_is_valid(prng->yarrow.cipher)) != CRYPT_OK) { + return err; + } + +#ifdef SHA256 + prng->yarrow.hash = register_hash(&sha256_desc); +#elif defined(SHA512) + prng->yarrow.hash = register_hash(&sha512_desc); +#elif defined(TIGER) + prng->yarrow.hash = register_hash(&tiger_desc); +#elif defined(SHA1) + prng->yarrow.hash = register_hash(&sha1_desc); +#elif defined(RIPEMD160) + prng->yarrow.hash = register_hash(&rmd160_desc); +#elif defined(RIPEMD128) + prng->yarrow.hash = register_hash(&rmd128_desc); +#elif defined(MD5) + prng->yarrow.hash = register_hash(&md5_desc); +#elif defined(MD4) + prng->yarrow.hash = register_hash(&md4_desc); +#elif defined(MD2) + prng->yarrow.hash = register_hash(&md2_desc); +#elif defined(WHIRLPOOL) + prng->yarrow.hash = register_hash(&whirlpool_desc); +#else + #error YARROW needs at least one HASH +#endif + if ((err = hash_is_valid(prng->yarrow.hash)) != CRYPT_OK) { + return err; + } + + /* zero the memory used */ + zeromem(prng->yarrow.pool, sizeof(prng->yarrow.pool)); + + return CRYPT_OK; +} + +int yarrow_add_entropy(const unsigned char *buf, unsigned long len, prng_state *prng) +{ + hash_state md; + int err; + + _ARGCHK(buf != NULL); + _ARGCHK(prng != NULL); + + if ((err = hash_is_valid(prng->yarrow.hash)) != CRYPT_OK) { + return err; + } + + /* start the hash */ + hash_descriptor[prng->yarrow.hash].init(&md); + + /* hash the current pool */ + if ((err = hash_descriptor[prng->yarrow.hash].process(&md, prng->yarrow.pool, + hash_descriptor[prng->yarrow.hash].hashsize)) != CRYPT_OK) { + return err; + } + + /* add the new entropy */ + if ((err = hash_descriptor[prng->yarrow.hash].process(&md, buf, len)) != CRYPT_OK) { + return err; + } + + /* store result */ + if ((err = hash_descriptor[prng->yarrow.hash].done(&md, prng->yarrow.pool)) != CRYPT_OK) { + return err; + } + + return CRYPT_OK; +} + +int yarrow_ready(prng_state *prng) +{ + int ks, err; + + _ARGCHK(prng != NULL); + + if ((err = hash_is_valid(prng->yarrow.hash)) != CRYPT_OK) { + return err; + } + + if ((err = cipher_is_valid(prng->yarrow.cipher)) != CRYPT_OK) { + return err; + } + + /* setup CTR mode using the "pool" as the key */ + ks = (int)hash_descriptor[prng->yarrow.hash].hashsize; + if ((err = cipher_descriptor[prng->yarrow.cipher].keysize(&ks)) != CRYPT_OK) { + return err; + } + + if ((err = ctr_start(prng->yarrow.cipher, /* what cipher to use */ + prng->yarrow.pool, /* IV */ + prng->yarrow.pool, ks, /* KEY and key size */ + 0, /* number of rounds */ + &prng->yarrow.ctr)) != CRYPT_OK) { + return err; + } + return CRYPT_OK; +} + +unsigned long yarrow_read(unsigned char *buf, unsigned long len, prng_state *prng) +{ + _ARGCHK(buf != NULL); + _ARGCHK(prng != NULL); + + /* put buf in predictable state first */ + zeromem(buf, len); + + /* now randomize it */ + if (ctr_encrypt(buf, buf, len, &prng->yarrow.ctr) != CRYPT_OK) { + return 0; + } + return len; +} + +#endif +